English · KJV

Isaiah10

Listen to this chapter
0:00 0:00
406 Hebrew words

Woe Against Unjust Rulers

1
  1. הוֹיHowoe to!H1945PrtParticle Interjection
  2. הַחֹקְקִיםha·cho·ke·Kimthose [who] decreeH2710Art ¦ V-Qal-Prtcpl-mpVerb Qal Participle Plural Masculine Absoluteהַthoseחֹקְקִים[who] decree
  3. חִקְקֵיchi·keidecrees ofH2711N-mpcNoun Plural Masculine Construct
  4. אָוֶן'A·venwickednessH205N-msNoun Singular Masculine Absolute
  5. וּמְכַתְּבִיםu·me·kha·te·Vimand writersH3789Conj-w ¦ V-Piel-Prtcpl-mpVerb Piel Participle Plural Masculine Absoluteוּandמְכַתְּבִיםwriters
  6. עָמָל'a·Mal[who] troubleH5999N-csNoun Singular common gender Absolute
  7. כִּתֵּבוּki·Te·vuthey wroteH3789V-Piel-Perf-3cpVerb Piel Perfect 3rd Plural common gender
2
  1. לְהַטּוֹתle·ha·Totto turn asideH5186Prep-l ¦ V-Hiphil-InfVerb Hiphil Infinitive Constructלְtoהַטּוֹתturn aside
  2. מִדִּיןmi·Dinfrom judgmentH1779Prep-m ¦ N-msNoun Singular Masculine Absoluteמִfromדִּיןjudgment
  3. דַּלִּיםda·Limpoor [people]H1800Adj-mpAdjective Plural Masculine Absolute
  4. וְלִגְזֹלve·lig·Zoland to take awayH1497Conj-w ¦ Prep-l ¦ V-Qal-InfVerb Qal Infinitive Constructוְandלִtoגְזֹלtake away
  5. מִשְׁפַּטmish·Pat[the] justice ofH4941N-mscNoun Singular Masculine Construct
  6. עֲנִיֵּי'a·ni·Yei[the] poor [people] ofH6041Adj-mpcAdjective Plural Masculine Construct
  7. עַמִּי'a·Mimy peopleH5971N-msc ¦ 1csNoun Singular Masculine Constructעַמִּpeopleיmy
  8. לִהְיוֹתlih·Yotto beH1961Prep-l ¦ V-Qal-InfVerb Qal Infinitive Constructלִtoהְיוֹתbe
  9. אַלְמָנוֹת'al·ma·nOtwidowsH490N-fpNoun Plural Feminine Absolute
  10. שְׁלָלָםshe·la·Lamtheir preyH7998N-msc ¦ 3mpNoun Singular Masculine Constructשְׁלָלָpreyםtheir
  11. וְאֶתve·'Etand <obj.>H853Conj-w ¦ DirObjMParticle Object Indicatorוְandאֶת<obj.>
  12. יְתוֹמִיםye·to·Mimfatherless onesH3490N-mpNoun Plural Masculine Absolute
  13. יָבֹזּוּya·Vo·zuthey will plunderH962V-Qal-Imperf-3mpVerb Qal Imperfect 3rd Plural Masculine
3
  1. וּמַהu·mahand what?H4100Conj-w ¦ InterrogPronoun Interrogativeוּandמַהwhat?
  2. תַּעֲשׂוּta·'a·Suwill you doH6213V-Qal-Imperf-2mpVerb Qal Imperfect 2nd Plural Masculine
  3. לְיוֹםle·Yomto [the] day ofH3117Prep-l ¦ N-mscNoun Singular Masculine Constructלְtoיוֹם[the] day of
  4. פְּקֻדָּהpe·ku·DahpunishmentH6486N-fsNoun Singular Feminine Absolute
  5. וּלְשׁוֹאָהu·le·sho·'Ahand to [the] devastationH7722Conj-w ¦ Prep-l ¦ N-fsNoun Singular Feminine Absoluteוּandלְtoשׁוֹאָה[the] devastation
  6. מִמֶּרְחָקmi·mer·Chak[which] from a distanceH4801Prep-m ¦ N-msNoun Singular Masculine Absoluteמִ[which] fromמֶּרְחָקa distance
  7. תָּבוֹאta·Vo'it will comeH935V-Qal-Imperf-3fsVerb Qal Imperfect 3rd Singular Feminine
  8. עַל'altoH5921PrepPreposition
  9. מִיmiwhom?H4310InterrogPronoun Interrogative
  10. תָּנוּסוּta·Nu·suwill you fleeH5127V-Qal-Imperf-2mpVerb Qal Imperfect 2nd Plural Masculine
  11. לְעֶזְרָהle·'ez·Rahfor helpH5833Prep-l ¦ N-fsNoun Singular Feminine Absoluteלְforעֶזְרָהhelp
  12. וְאָנָהve·'A·nahand where?H575Conj-w ¦ InterrogParticle Interrogativeוְandאָנָהwhere?
  13. תַעַזְבוּta·'az·Vuwill you leaveH5800V-Qal-Imperf-2mpVerb Qal Imperfect 2nd Plural Masculine
  14. כְּבוֹדְכֶםke·Vod·Khemyour abundanceH3519N-msc ¦ 2mpNoun Singular Masculine Constructכְּבוֹדְabundanceכֶםyour
4
  1. בִּלְתִּיbil·TiexceptH1115N-csNoun Singular common gender Absolute
  2. כָרַעkha·Ra'anyone kneeled downH3766V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  3. תַּחַתTa·chatunderH8478N-mscNoun Singular Masculine Construct
  4. אַסִּיר'a·Sirprisoner[s]H616N-msNoun Singular Masculine Absolute
  5. וְתַחַתve·Ta·chatand underH8478Conj-w ¦ N-mscNoun Singular Masculine Constructוְandתַחַתunder
  6. הֲרוּגִיםha·ru·Gim[the] slain [people]H2026V-Qal-PassPrtcpl-mpVerb Qal Participle Passive Plural Masculine Absolute
  7. יִפֹּלוּyi·Po·luthey will fallH5307V-Qal-Imperf-3mpVerb Qal Imperfect 3rd Plural Masculine
  8. בְּכָלbe·kholfor allH3605Prep-b ¦ N-mscNoun Singular Masculine Constructבְּforכָלall
  9. זֹאתzoTthisH2063PrtParticle Demonstrative
  10. לֹאlo'notH3808NegParticle Negative
  11. שָׁבshavit has turned backH7725V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  12. אַפּוֹ'a·Pohis angerH639N-msc ¦ 3msNoun Singular Masculine Constructאַפּangerוֹhis
  13. וְעוֹדve·'odand stillH5750Conj-w ¦ Adj-msAdjective Numerical Singular Masculine Absoluteוְandעוֹדstill
  14. יָדוֹya·Dohis handH3027N-csc ¦ 3msNoun Singular common gender Constructיָדhandוֹhis
  15. נְטוּיָהne·tu·Yah[is] stretched outH5186V-Qal-PassPrtcpl-fsVerb Qal Participle Passive Singular Feminine Absolute

Assyria: The Rod of God's Anger

5
  1. הוֹיHowoe to!H1945PrtParticle Interjection
  2. אַשּׁוּר'a·ShurAssyriaH804N-properNoun Proper Location
  3. שֵׁבֶטShe·vet[the] rod ofH7626N-mscNoun Singular Masculine Construct
  4. אַפִּי'a·Pimy angerH639N-msc ¦ 1csNoun Singular Masculine Constructאַפִּangerיmy
  5. וּמַטֶּהu·ma·tehand [is] a staffH4294Conj-w ¦ N-msNoun Singular Masculine Absoluteוּandמַטֶּה[is] a staff
  6. הוּאhu'itH1931Pro-3msPronoun Personal 3rd Singular Masculine
  7. בְיָדָםve·ya·Damin their handH3027Prep-b ¦ N-csc ¦ 3mpNoun Singular common gender Constructבְinיָדָhandםtheir
  8. זַעְמִיza'·Mimy indignationH2195N-msc ¦ 1csNoun Singular Masculine Constructזַעְמִindignationיmy
6
  1. בְּגוֹיbe·Goyon a nationH1471Prep-b ¦ N-msNoun Singular Masculine Absoluteבְּonגוֹיa nation
  2. חָנֵףcha·NefgodlessH2611Adj-msAdjective Singular Masculine Absolute
  3. אֲשַׁלְּחֶנּוּ'a·shal·le·Che·nuI sent himH7971V-Piel-Imperf-1cs ¦ 3msVerb Piel Imperfect 1st Singular common genderאֲשַׁלְּחֶI sentנּוּhim
  4. וְעַלve·'aland onH5921Conj-w ¦ PrepPrepositionוְandעַלon
  5. עַם'am[the] people ofH5971N-mscNoun Singular Masculine Construct
  6. עֶבְרָתִי'ev·ra·Timy wrathH5678N-fsc ¦ 1csNoun Singular Feminine Constructעֶבְרָתִwrathיmy
  7. אֲצַוֶּנּוּ'a·tzav·Ve·nuI commanded himH6680V-Piel-Imperf-1cs ¦ 3msVerb Piel Imperfect 1st Singular common genderאֲצַוֶּI commandedנּוּhim
  8. לִשְׁלֹלlish·Lolto plunderH7997Prep-l ¦ V-Qal-InfVerb Qal Infinitive Constructלִtoשְׁלֹלplunder
  9. שָׁלָלsha·LalplunderH7998N-msNoun Singular Masculine Absolute
  10. וְלָבֹזve·la·Vozand to take as spoilH962Conj-w ¦ Prep-l ¦ V-Qal-InfVerb Qal Infinitive Constructוְandלָtoבֹזtake as spoil
  11. בַּזBazspoilH957N-msNoun Singular Masculine Absolute
  12. וּלְשׂוּמוֹu·le·si·movand to make itH7760Conj-w ¦ Prep-l ¦ V-Qal-Inf ¦ 3msVerb Qal Infinitive Constructוּandלְtoשׂוּמmakeוֹit
  13. מִרְמָסmir·Masa trampling placeH4823N-msNoun Singular Masculine Absolute
  14. כְּחֹמֶרke·Cho·merlike [the] mud ofH2563Prep-k ¦ N-mscNoun Singular Masculine Constructכְּlikeחֹמֶר[the] mud of
  15. חוּצוֹתchu·Tzot[the] streetsH2351N-fpNoun Plural Feminine Absolute
7
  1. וְהוּאve·Hu'and heH1931Conj-w ¦ Pro-3msPronoun Personal 3rd Singular Masculineוְandהוּאhe
  2. לֹאlo'notH3808NegParticle Negative
  3. כֵןkhenthusH3651AdvAdverb
  4. יְדַמֶּהye·da·Mehhe intendedH1819V-Piel-Imperf-3msVerb Piel Imperfect 3rd Singular Masculine
  5. וּלְבָבוֹu·le·va·Voand his heartH3824Conj-w ¦ N-msc ¦ 3msNoun Singular Masculine Constructוּandלְבָבheartוֹhis
  6. לֹאlo'notH3808NegParticle Negative
  7. כֵןkhenthusH3651AdvAdverb
  8. יַחְשֹׁבyach·Shoit plannedH2803V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  9. כִּיkiforH3588PrtParticle Conditional
  10. לְהַשְׁמִידle·hash·Midto destroyH8045Prep-l ¦ V-Hiphil-InfVerb Hiphil Infinitive Constructלְtoהַשְׁמִידdestroy
  11. בִּלְבָבוֹbil·va·Vo[is] in his heartH3824Prep-b ¦ N-msc ¦ 3msNoun Singular Masculine Constructבִּ[is] inלְבָבheartוֹhis
  12. וּלְהַכְרִיתu·le·hakh·Ritand to cut offH3772Conj-w ¦ Prep-l ¦ V-Hiphil-InfVerb Hiphil Infinitive Constructוּandלְtoהַכְרִיתcut off
  13. גּוֹיִםgo·YimnationsH1471N-mpNoun Plural Masculine Absolute
  14. לֹאlo'notH3808NegParticle Negative
  15. מְעָטme·'Ata fewH4592N-msNoun Singular Masculine Absolute
8
  1. כִּיkiforH3588PrtParticle Conditional
  2. יֹאמַרyo·Marhe saidH559V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  3. הֲלֹאha·Lo'¿ notH3808Interrog ¦ NegParticle Negativeהֲ¿לֹאnot
  4. שָׂרַיsa·Rai[are] my commandersH8269N-mpc ¦ 1csNoun Plural Masculine Constructשָׂרַ[are] commandersיmy
  5. יַחְדָּוyach·DavalikeH3162AdvAdverb
  6. מְלָכִיםme·la·KhimkingsH4428N-mpNoun Plural Masculine Absolute
9
  1. הֲלֹאha·Lo'¿ notH3808Interrog ¦ NegParticle Negativeהֲ¿לֹאnot
  2. כְּכַרְכְּמִישׁke·khar·ke·Mishlike CarchemishH3751Prep-k ¦ N-properNoun Proper LocationכְּlikeכַרְכְּמִישׁCarchemish
  3. כַּלְנוֹkal·No[is] CalnehH3641N-properNoun Proper Location
  4. אִם'imor?H518PrtParticle Conditional
  5. לֹאlo'notH3808NegParticle Negative
  6. כְאַרְפַּדkhe·'ar·Padlike ArpadH774Prep-k ¦ N-properNoun Proper LocationכְlikeאַרְפַּדArpad
  7. חֲמָתcha·Mat[is] HamathH2574N-properNoun Proper Location
  8. אִם'imor?H518PrtParticle Conditional
  9. לֹאlo'notH3808NegParticle Negative
  10. כְדַמֶּשֶׂקkhe·da·Me·seklike DamascusH1834Prep-k ¦ N-properNoun Proper LocationכְlikeדַמֶּשֶׂקDamascus
  11. שֹׁמְרוֹןsho·me·Ron[is] SamariaH8111N-properNoun Proper Location
10
  1. כַּאֲשֶׁרka·'a·Sherjust asH834Prep-k ¦ RelParticle Relativeכַּjustאֲשֶׁרas
  2. מָצְאָהma·tze·'Ahit has foundH4672V-Qal-Perf-3fsVerb Qal Perfect 3rd Singular Feminine
  3. יָדִיya·Dimy handH3027N-csc ¦ 1csNoun Singular common gender Constructיָדִhandיmy
  4. לְמַמְלְכֹתle·mam·le·Khot<to> [the] kingdoms ofH4467Prep-l ¦ N-fpcNoun Plural Feminine Constructלְ<to>מַמְלְכֹת[the] kingdoms of
  5. הָאֱלִילha·'e·Lilthe idolH457Art ¦ N-msNoun Singular Masculine Absoluteהָtheאֱלִילidol
  6. וּפְסִילֵיהֶםu·fe·Si·lei·Hemand their imagesH6456Conj-w ¦ N-mpc ¦ 3mpNoun Plural Masculine Constructוּandפְסִילֵיimagesהֶםtheir
  7. מִירוּשָׁלִַםmi·ru·sha·Lim[were] more than JerusalemH3389Prep-m ¦ N-properNoun Proper Locationמִ[were] more thanירוּשָׁלִַםJerusalem
  8. וּמִשֹּׁמְרוֹןu·mi·sho·me·Ronand more than SamariaH8111Conj-w ¦ Prep-m ¦ N-properNoun Proper Locationוּandמִmore thanשֹּׁמְרוֹןSamaria
11
  1. הֲלֹאha·Lo'¿ notH3808Interrog ¦ NegParticle Negativeהֲ¿לֹאnot
  2. כַּאֲשֶׁרka·'a·Sherjust asH834Prep-k ¦ RelParticle Relativeכַּjustאֲשֶׁרas
  3. עָשִׂיתִי'a·Si·tiI didH6213V-Qal-Perf-1csVerb Qal Perfect 1st Singular common gender
  4. לְשֹׁמְרוֹןle·sho·me·Ronto SamariaH8111Prep-l ¦ N-properNoun Proper LocationלְtoשֹׁמְרוֹןSamaria
  5. וְלֶאֱלִילֶיהָve·le·'e·li·Lei·haand to its idolsH457Conj-w ¦ Prep-l ¦ N-mpc ¦ 3fsNoun Plural Masculine Constructוְandלֶtoאֱלִילֶיidolsהָits
  6. כֵּןkensoH3651AdvAdverb
  7. אֶעֱשֶׂה'e·'e·Sehwill I doH6213V-Qal-Imperf-1csVerb Qal Imperfect 1st Singular common gender
  8. לִירוּשָׁלִַםli·ru·sha·Limto JerusalemH3389Prep-l ¦ N-properNoun Proper LocationלִtoירוּשָׁלִַםJerusalem
  9. וְלַעֲצַבֶּיהָve·la·'a·tza·Bei·haand to its imagesH6091Conj-w ¦ Prep-l ¦ N-mpc ¦ 3fsNoun Plural Masculine Constructוְandלַtoעֲצַבֶּיimagesהָits

The Lord Will Punish Assyrian Pride

12
  1. וְהָיָהve·ha·Yahand it will beH1961Conj-w ¦ V-Qal-ConsecPerf-3msVerb Qal Consecutive Perfect 3rd Singular Masculineוְandהָיָהit will be
  2. כִּיkithatH3588PrtParticle Conditional
  3. יְבַצַּעye·va·Tza'he will finishH1214V-Piel-Imperf-3msVerb Piel Imperfect 3rd Singular Masculine
  4. אֲדֹנָי'a·do·Nai[the] LordH136N-properNoun Proper Title
  5. אֶת'et<obj.>H853DirObjMParticle Object Indicator
  6. כָּלkolallH3605N-mscNoun Singular Masculine Construct
  7. מַעֲשֵׂהוּma·'a·Se·huhis workH4639N-msc ¦ 3msNoun Singular Masculine Constructמַעֲשֵׂworkהוּhis
  8. בְּהַרbe·Haron [the] mountain ofH2022Prep-b ¦ N-mscNoun Singular Masculine Constructבְּonהַר[the] mountain of
  9. צִיּוֹןtzi·YonZionH6726N-properNoun Proper Location
  10. וּבִירוּשָׁלִָםu·vi·ru·sha·Limand in JerusalemH3389Conj-w ¦ Prep-b ¦ N-properNoun Proper LocationוּandבִinירוּשָׁלִָםJerusalem
  11. אֶפְקֹד'ef·KodI will visit [judgment]H6485V-Qal-Imperf-1csVerb Qal Imperfect 1st Singular common gender
  12. עַל'alonH5921PrepPreposition
  13. פְּרִיpe·ri[the] fruit ofH6529N-mscNoun Singular Masculine Construct
  14. גֹדֶלgo·del[the] greatness ofH1433N-mscNoun Singular Masculine Construct
  15. לְבַבle·Vav[the] heart ofH3824N-mscNoun Singular Masculine Construct
  16. מֶלֶךְMe·lekh[the] king ofH4428N-mscNoun Singular Masculine Construct
  17. אַשּׁוּר'a·ShurAssyriaH804N-properNoun Proper Location
  18. וְעַלve·'aland onH5921Conj-w ¦ PrepPrepositionוְandעַלon
  19. תִּפְאֶרֶתtif·'E·ret[the] glory ofH8597N-fscNoun Singular Feminine Construct
  20. רוּםrum[the] haughtiness ofH7312N-mscNoun Singular Masculine Construct
  21. עֵינָיו'ei·Navhis eyesH5869N-fdc ¦ 3msNoun Dual Feminine Constructעֵינָיeyesוhis
13
  1. כִּיkiforH3588PrtParticle Conditional
  2. אָמַר'a·Marhe has saidH559V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  3. בְּכֹחַbe·Kho·achby [the] strength ofH3581Prep-b ¦ N-mscNoun Singular Masculine Constructבְּbyכֹחַ[the] strength of
  4. יָדִיya·Dimy handH3027N-csc ¦ 1csNoun Singular common gender Constructיָדִhandיmy
  5. עָשִׂיתִי'a·Si·tiI have actedH6213V-Qal-Perf-1csVerb Qal Perfect 1st Singular common gender
  6. וּבְחָכְמָתִיu·ve·cha·khe·ma·Tiand by my skillH2451Conj-w ¦ Prep-b ¦ N-fsc ¦ 1csNoun Singular Feminine Constructוּandבְbyחָכְמָתִskillיmy
  7. כִּיkiforH3588PrtParticle Conditional
  8. נְבֻנוֹתִיne·vu·No·tiI have understandingH995V-Niphal-Perf-1csVerb Niphal Perfect 1st Singular common gender
  9. וְאָסִירve·'a·Sirand I may removeH5493Conj-w ¦ V-Hiphil-ConjImperf-1csVerb Hiphil Conjunction+Imperfect 1st Singular common genderוְandאָסִירI may remove
  10. גְּבוּלֹתge·vu·Lot[the] boundaries ofH1367N-fpcNoun Plural Feminine Construct
  11. עַמִּים'a·MimpeoplesH5971N-mpNoun Plural Masculine Absolute
  12. וַעֲתוּדוֹתֵיהֶםva·'a·ti·do·tei·hemand their provisionsH6259Conj-w ¦ N-fpc ¦ 3mpNoun Plural Feminine Constructוַandעֲתוּדוֹתֵיprovisionsהֶםtheir
  13. שׁוֹשֵׂתִיsho·Se·tiI have plunderedH8154V-Piel-Perf-1csVerb Piel Perfect 1st Singular common gender
  14. וְאוֹרִידve·'o·Ridand I may bring downH3381Conj-w ¦ V-Hiphil-ConjImperf-1csVerb Hiphil Conjunction+Imperfect 1st Singular common genderוְandאוֹרִידI may bring down
  15. כַּאבִּירka·Birlike a mighty [man]H47Prep-k ¦ Adj-msAdjective Singular Masculine Absoluteכַּlikeאבִּירa mighty [man]
  16. יוֹשְׁבִיםyo·she·ViminhabitantsH3427V-Qal-Prtcpl-mpVerb Qal Participle Plural Masculine Absolute
14
  1. וַתִּמְצָאva·tim·Tza'and it has foundH4672Conj-w ¦ V-Qal-ConsecImperf-3fsVerb Qal Consecutive Imperfect 3rd Singular Feminineוַandתִּמְצָאit has found
  2. כַקֵּןkha·Kenlike <the> nestH7064Prep-k ¦ N-msNoun Singular Masculine Absoluteכַlike <the>קֵּןnest
  3. יָדִיya·Dimy handH3027N-csc ¦ 1csNoun Singular common gender Constructיָדִhandיmy
  4. לְחֵילle·Cheil<to> [the] wealth ofH2428Prep-l ¦ N-mscNoun Singular Masculine Constructלְ<to>חֵיל[the] wealth of
  5. הָעַמִּיםha·'a·Mimthe peoplesH5971Art ¦ N-mpNoun Plural Masculine Absoluteהָtheעַמִּיםpeoples
  6. וְכֶאֱסֹףve·khe·'e·Sofand as gathersH622Conj-w ¦ Prep-k ¦ V-Qal-InfVerb Qal Infinitive Constructוְandכֶasאֱסֹףgathers
  7. בֵּיצִיםbei·TzimeggsH1000N-mpNoun Plural Masculine Absolute
  8. עֲזֻבוֹתa·zu·VotabandonedH5800V-Qal-PassPrtcpl-fpVerb Qal Participle Passive Plural Feminine Absolute
  9. כָּלkolallH3605N-mscNoun Singular Masculine Construct
  10. הָאָרֶץha·'A·retzthe earthH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץearth
  11. אֲנִי'a·NiIH589Pro-1csPronoun Personal 1st Singular common gender
  12. אָסָפְתִּי'a·Sa·fe·tiI have gatheredH622V-Qal-Perf-1csVerb Qal Perfect 1st Singular common gender
  13. וְלֹאve·Lo'and notH3808Conj-w ¦ NegParticle Negativeוְandלֹאnot
  14. הָיָהha·Yahany wasH1961V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  15. נֹדֵדno·DedflutteringH5074V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absolute
  16. כָּנָףka·Nafa wingH3671N-fsNoun Singular Feminine Absolute
  17. וּפֹצֶהu·fo·Tzehand openingH6475Conj-w ¦ V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absoluteוּandפֹצֶהopening
  18. פֶהfeha mouthH6310N-msNoun Singular Masculine Absolute
  19. וּמְצַפְצֵףu·me·tzaf·Tzefand chirpingH6850Conj-w ¦ V-Piel-Prtcpl-msVerb Piel Participle Singular Masculine Absoluteוּandמְצַפְצֵףchirping
15
  1. הֲיִתְפָּאֵרha·yit·pa·'Er¿ does it glorify itselfH6286Interrog ¦ V-Hithpael-Imperf-3msVerb Hithpael Imperfect 3rd Singular Masculineהֲ¿יִתְפָּאֵרdoes it glorify itself
  2. הַגַּרְזֶןha·gar·Zenthe axeH1631Art ¦ N-msNoun Singular Masculine Absoluteהַtheגַּרְזֶןaxe
  3. עַל'alaboveH5921PrepPreposition
  4. הַחֹצֵבha·cho·Tzevthe [one who] cutsH2672Art ¦ V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absoluteהַtheחֹצֵב[one who] cuts
  5. בּוֹbowith itPrep-b ¦ 3msSuffix Personal 3rd Singular Masculineבּwithוֹit
  6. אִם'imor?H518PrtParticle Conditional
  7. יִתְגַּדֵּלyit·ga·Deldoes it magnify itselfH1431V-Hithpael-Imperf-3msVerb Hithpael Imperfect 3rd Singular Masculine
  8. הַמַּשּׂוֹרha·ma·sOrthe sawH4883Art ¦ N-msNoun Singular Masculine Absoluteהַtheמַּשּׂוֹרsaw
  9. עַל'alaboveH5921PrepPreposition
  10. מְנִיפוֹme·ni·Fo[the] [one who] wields itH5130V-Hiphil-Prtcpl-ms ¦ 3msVerb Hiphil Participle Singular Masculine Constructמְנִיפ[the] [one who] wieldsוֹit
  11. כְּהָנִיףke·ha·Nifas wieldsH5130Prep-k ¦ V-Hiphil-InfVerb Hiphil Infinitive Constructכְּasהָנִיףwields
  12. שֵׁבֶטshe·veta rodH7626N-msNoun Singular Masculine Absolute
  13. וְאֶתve·'Et<and> <obj.>H853Conj-w ¦ DirObjMParticle Object Indicatorוְ<and>אֶת<obj.>
  14. מְרִימָיוme·ri·Mav[those who] lift itH7311V-Hiphil-Prtcpl-mp ¦ 3msVerb Hiphil Participle Plural Masculine Constructמְרִימָי[those who] liftוit
  15. כְּהָרִיםke·ha·Rimas liftsH7311Prep-k ¦ V-Hiphil-InfVerb Hiphil Infinitive Constructכְּasהָרִיםlifts
  16. מַטֶּהma·Teha staffH4294N-msNoun Singular Masculine Absolute
  17. לֹאlo'notH3808NegParticle Negative
  18. עֵץ'EtzwoodH6086N-msNoun Singular Masculine Absolute
16
  1. לָכֵןLa·khen<to> thereforeH3651Prep-l ¦ AdvAdverbלָ<to>כֵןtherefore
  2. יְשַׁלַּחye·sha·Lachhe will sendH7971V-Piel-Imperf-3msVerb Piel Imperfect 3rd Singular Masculine
  3. הָאָדוֹןha·'a·Donthe lordH113Art ¦ N-msNoun Singular Masculine Absoluteהָtheאָדוֹןlord
  4. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  5. צְבָאוֹתtze·va·'otof hostsH6635N-fpNoun Plural Feminine Absolute
  6. בְּמִשְׁמַנָּיוbe·mish·ma·Navon his fat onesH4924Prep-b ¦ N-mpc ¦ 3msNoun Plural Masculine Constructבְּonמִשְׁמַנָּיfat onesוhis
  7. רָזוֹןra·ZonleannessH7332N-msNoun Singular Masculine Absolute
  8. וְתַחַתve·Ta·chatand underH8478Conj-w ¦ N-mscNoun Singular Masculine Constructוְandתַחַתunder
  9. כְּבֹדוֹke·vo·Dohis gloryH3519N-msc ¦ 3msNoun Singular Masculine Constructכְּבֹדgloryוֹhis
  10. יֵקַדye·Kadit will burnH3344V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  11. יְקֹדye·Koda burningH3350N-msNoun Singular Masculine Absolute
  12. כִּיקוֹדki·Kodlike [the] burning ofH3350Prep-k ¦ N-mscNoun Singular Masculine Constructכִּlikeיקוֹד[the] burning of
  13. אֵשׁ'EshfireH784N-csNoun Singular common gender Absolute
17
  1. וְהָיָהve·ha·Yahand it will becomeH1961Conj-w ¦ V-Qal-ConsecPerf-3msVerb Qal Consecutive Perfect 3rd Singular Masculineוְandהָיָהit will become
  2. אוֹר'or[the] light ofH216N-fscNoun Singular Feminine Construct
  3. יִשְׂרָאֵלYis·ra·'ElIsraelH3478N-properNoun Proper Location
  4. לְאֵשׁle·'Esh<into> a fireH784Prep-l ¦ N-csNoun Singular common gender Absoluteלְ<into>אֵשׁa fire
  5. וּקְדוֹשׁוֹu·ke·do·Shoand its holy [one]H6918Conj-w ¦ Adj-msc ¦ 3msAdjective Singular Masculine Constructוּandקְדוֹשׁholy [one]וֹits
  6. לְלֶהָבָהle·le·ha·Vah<into> a flameH3852Prep-l ¦ N-fsNoun Singular Feminine Absoluteלְ<into>לֶהָבָהa flame
  7. וּבָעֲרָהu·va·'a·Rahand it will burnH1197Conj-w ¦ V-Qal-ConsecPerf-3fsVerb Qal Consecutive Perfect 3rd Singular Feminineוּandבָעֲרָהit will burn
  8. וְאָכְלָהve·'a·khe·Lahand it will consumeH398Conj-w ¦ V-Qal-ConsecPerf-3fsVerb Qal Consecutive Perfect 3rd Singular Feminineוְandאָכְלָהit will consume
  9. שִׁיתוֹshi·Tohis bush[es]H7898N-msc ¦ 3msNoun Singular Masculine Constructשִׁיתbush[es]וֹhis
  10. וּשְׁמִירוֹu·she·mi·Roand his thorn[s]H8068Conj-w ¦ N-msc ¦ 3msNoun Singular Masculine Constructוּandשְׁמִירthorn[s]וֹhis
  11. בְּיוֹםbe·Yomin a dayH3117Prep-b ¦ N-msNoun Singular Masculine Absoluteבְּinיוֹםa day
  12. אֶחָד'e·ChadoneH259Adj-fsAdjective Numerical Singular Feminine Absolute
18
  1. וּכְבוֹדu·khe·Vodand [the] splendor ofH3519Conj-w ¦ N-mscNoun Singular Masculine Constructוּandכְבוֹד[the] splendor of
  2. יַעְרוֹya'·Rohis forestH3293N-msc ¦ 3msNoun Singular Masculine Constructיַעְרforestוֹhis
  3. וְכַרְמִלּוֹve·khar·mi·Loand his orchardH3759Conj-w ¦ N-msc ¦ 3msNoun Singular Masculine Constructוְandכַרְמִלּorchardוֹhis
  4. מִנֶּפֶשׁmi·Ne·feshfrom breathH5315Prep-m ¦ N-fsNoun Singular Feminine Absoluteמִfromנֶּפֶשׁbreath
  5. וְעַדve·'adand untoH5704Conj-w ¦ PrepPrepositionוְandעַדunto
  6. בָּשָׂרba·SarfleshH1320N-msNoun Singular Masculine Absolute
  7. יְכַלֶּהye·kha·Lehit will bring to an endH3615V-Piel-Imperf-3msVerb Piel Imperfect 3rd Singular Masculine
  8. וְהָיָהve·ha·Yahand it will beH1961Conj-w ¦ V-Qal-ConsecPerf-3msVerb Qal Consecutive Perfect 3rd Singular Masculineוְandהָיָהit will be
  9. כִּמְסֹסkim·Sosas wastes awayH4549Prep-k ¦ V-Qal-InfVerb Qal Infinitive Constructכִּasמְסֹסwastes away
  10. נֹסֵסno·Ses[one who] is sickH5263V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absolute
19
  1. וּשְׁאָרu·she·'Arand [the] remnant ofH7605Conj-w ¦ N-mscNoun Singular Masculine Constructוּandשְׁאָר[the] remnant of
  2. עֵץ'etz[the] tree[s] ofH6086N-mscNoun Singular Masculine Construct
  3. יַעְרוֹya'·Rohis forestH3293N-msc ¦ 3msNoun Singular Masculine Constructיַעְרforestוֹhis
  4. מִסְפָּרmis·Para numberH4557N-msNoun Singular Masculine Absolute
  5. יִהְיוּyih·Yuthey will beH1961V-Qal-Imperf-3mpVerb Qal Imperfect 3rd Plural Masculine
  6. וְנַעַרve·Na·'arand a childH5288Conj-w ¦ N-msNoun Singular Masculine Absoluteוְandנַעַרa child
  7. יִכְתְּבֵםyikh·te·Vemhe will record themH3789V-Qal-Imperf-3ms ¦ 3mpVerb Qal Imperfect 3rd Singular Masculineיִכְתְּבֵhe will recordםthem

The Remnant Shall Return

20
  1. וְהָיָהve·ha·Yahand it will beH1961Conj-w ¦ V-Qal-ConsecPerf-3msVerb Qal Consecutive Perfect 3rd Singular Masculineוְandהָיָהit will be
  2. בַּיּוֹםbai·Yomin the dayH3117Prep-b ¦ N-msNoun Singular Masculine Absoluteבַּin theיּוֹםday
  3. הַהוּאha·Hu'<the> thatH1931Art ¦ Pro-3msPronoun Personal 3rd Singular Masculineהַ<the>הוּאthat
  4. לֹאlo'notH3808NegParticle Negative
  5. יוֹסִיףyo·Sifit will repeatH3254V-Hiphil-Imperf-3msVerb Hiphil Imperfect 3rd Singular Masculine
  6. עוֹדodagainH5750Adj-msAdjective Numerical Singular Masculine Absolute
  7. שְׁאָרshe·'Ar[the] remnant ofH7605N-mscNoun Singular Masculine Construct
  8. יִשְׂרָאֵלYis·ra·'ElIsraelH3478N-properNoun Proper Location
  9. וּפְלֵיטַתu·fe·lei·Tatand [the] escaped remnant ofH6413Conj-w ¦ N-fscNoun Singular Feminine Constructוּandפְלֵיטַת[the] escaped remnant of
  10. בֵּיתbeit[the] house ofH1004N-mscNoun Singular Masculine Construct
  11. יַעֲקֹבya·'a·KoJacobH3290N-proper-mNoun Proper Masculine
  12. לְהִשָּׁעֵןle·hi·sha·'Ento dependH8172Prep-l ¦ V-Niphal-InfVerb Niphal Infinitive Constructלְtoהִשָּׁעֵןdepend
  13. עַל'alonH5921PrepPreposition
  14. מַכֵּהוּma·Ke·hu[the] [one who] struck itH5221V-Hiphil-Prtcpl-ms ¦ 3msVerb Hiphil Participle Singular Masculine Constructמַכֵּ[the] [one who] struckהוּit
  15. וְנִשְׁעַןve·nish·'Anand it will dependH8172Conj-w ¦ V-Niphal-ConsecPerf-3msVerb Niphal Consecutive Perfect 3rd Singular Masculineוְandנִשְׁעַןit will depend
  16. עַל'alonH5921PrepPreposition
  17. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  18. קְדוֹשׁke·Do·osh[the] holy [one] ofH6918Adj-mscAdjective Singular Masculine Construct
  19. יִשְׂרָאֵלYis·ra·'ElIsraelH3478N-properNoun Proper Location
  20. בֶּאֱמֶתbe·'e·Metin truthH571Prep-b ¦ N-fsNoun Singular Feminine Absoluteבֶּinאֱמֶתtruth
21
  1. שְׁאָרshe·'Ara remnantH7605N-msNoun Singular Masculine Absolute
  2. יָשׁוּבya·Shuvit will returnH7725V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  3. שְׁאָרshe·'Ar[the] remnant ofH7605N-mscNoun Singular Masculine Construct
  4. יַעֲקֹבya·'a·KoJacobH3290N-proper-mNoun Proper Masculine
  5. אֶל'eltoH413PrepPreposition
  6. אֵל'el[the] GodH410N-mscNoun Singular Masculine Construct
  7. גִּבּוֹרgi·BormightyH1368N-msNoun Singular Masculine Absolute
22
  1. כִּיkithatH3588PrtParticle Conditional
  2. אִם'imthoughH518PrtParticle Conditional
  3. יִהְיֶהyih·Yehit will beH1961V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  4. עַמְּךָ'a·me·Khayour peopleH5971N-msc ¦ 2msNoun Singular Masculine Constructעַמְּpeopleךָyour
  5. יִשְׂרָאֵלYis·ra·'ElIsraelH3478N-properNoun Proper Location
  6. כְּחוֹלke·Chollike [the] sand ofH2344Prep-k ¦ N-mscNoun Singular Masculine Constructכְּlikeחוֹל[the] sand of
  7. הַיָּםhai·Yamthe seaH3220Art ¦ N-msNoun Singular Masculine Absoluteהַtheיָּםsea
  8. שְׁאָרshe·'Ara remnantH7605N-msNoun Singular Masculine Absolute
  9. יָשׁוּבya·Shuvit will returnH7725V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  10. בּוֹboin itPrep-b ¦ 3msSuffix Personal 3rd Singular Masculineבּinוֹit
  11. כִּלָּיוֹןki·la·YonannihilationH3631N-msNoun Singular Masculine Absolute
  12. חָרוּץcha·Rutz[has been] decidedH2782V-Qal-PassPrtcpl-msVerb Qal Participle Passive Singular Masculine Absolute
  13. שׁוֹטֵףsho·Tef[is] about to overflowH7857V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absolute
  14. צְדָקָהtze·da·KahrighteousnessH6666N-fsNoun Singular Feminine Absolute
23
  1. כִּיkiforH3588PrtParticle Conditional
  2. כָלָהkha·Lahcomplete destructionH3617N-fsNoun Singular Feminine Absolute
  3. וְנֶחֱרָצָהve·ne·che·ra·Tzahand [what] has been decidedH2782Conj-w ¦ V-Niphal-Prtcpl-fsVerb Niphal Participle Singular Feminine Absoluteוְandנֶחֱרָצָה[what] has been decided
  4. אֲדֹנָי'a·do·Nai[the] LordH136N-properNoun Proper Title
  5. יְהוִהYah·wehYahwehH3069N-properNoun Proper Title
  6. צְבָאוֹתtze·va·'otof hostsH6635N-fpNoun Plural Feminine Absolute
  7. עֹשֶׂה'o·Seh[is] about to doH6213V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absolute
  8. בְּקֶרֶבbe·Ke·revin [the] midst ofH7130Prep-b ¦ N-mscNoun Singular Masculine Constructבְּinקֶרֶב[the] midst of
  9. כָּלkolallH3605N-mscNoun Singular Masculine Construct
  10. הָאָרֶץha·'A·retzthe landH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץland

Comfort for Zion Against Assyria

24
  1. לָכֵןla·Khen<to> thereforeH3651Prep-l ¦ AdvAdverbלָ<to>כֵןtherefore
  2. כֹּהkohthusH3541AdvAdverb
  3. אָמַר'a·Marhe saysH559V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  4. אֲדֹנָי'a·do·Nai[the] LordH136N-properNoun Proper Title
  5. יְהוִהYah·wehYahwehH3069N-properNoun Proper Title
  6. צְבָאוֹתtze·va·'otof hostsH6635N-fpNoun Plural Feminine Absolute
  7. אַל'almay notH408NegParticle Negative
  8. תִּירָאti·Ra'you be afraidH3372V-Qal-Imperf-2msVerb Qal Imperfect 2nd Singular Masculine
  9. עַמִּי'a·Mimy O peopleH5971N-msc ¦ 1csNoun Singular Masculine ConstructעַמִּO peopleיmy
  10. יֹשֵׁבyo·Shev[which] dwellsH3427V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absolute
  11. צִיּוֹןtzi·YonZionH6726N-properNoun Proper Location
  12. מֵאַשּׁוּרme·'a·Shurfrom AssyriaH804Prep-m ¦ N-properNoun Proper LocationמֵfromאַשּׁוּרAssyria
  13. בַּשֵּׁבֶטba·She·vetwith the rodH7626Prep-b ¦ N-msNoun Singular Masculine Absoluteבַּwith theשֵּׁבֶטrod
  14. יַכֶּכָּהya·Ke·kahit will strike youH5221V-Hiphil-Imperf-3ms ¦ 2msVerb Hiphil Imperfect 3rd Singular Masculineיַכֶּit will strikeכָּהyou
  15. וּמַטֵּהוּu·ma·Te·huand its staffH4294Conj-w ¦ N-msc ¦ 3msNoun Singular Masculine Constructוּandמַטֵּstaffהוּits
  16. יִשָּׂאyi·sa'it will lift upH5375V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  17. עָלֶיךָ'a·Lei·khaon youH5921Prep ¦ 2msPrepositionעָלֶיonךָyou
  18. בְּדֶרֶךְbe·De·rekhin [the] manner ofH1870Prep-b ¦ N-cscNoun Singular common gender Constructבְּinדֶרֶךְ[the] manner of
  19. מִצְרָיִםmitz·Ra·yimEgyptH4714N-properNoun Proper Location
25
  1. כִּיkiforH3588PrtParticle Conditional
  2. עוֹדodyetH5750Adj-msAdjective Numerical Singular Masculine Absolute
  3. מְעַטme·'Ata little ofH4592N-mscNoun Singular Masculine Construct
  4. מִזְעָרmiz·'Ara littleH4213N-msNoun Singular Masculine Absolute
  5. וְכָלָהve·Kha·lahand it will be finishedH3615Conj-w ¦ V-Qal-ConsecPerf-3msVerb Qal Consecutive Perfect 3rd Singular Masculineוְandכָלָהit will be finished
  6. זַעַםZa·'amindignationH2195N-msNoun Singular Masculine Absolute
  7. וְאַפִּיve·'a·Piand my angerH639Conj-w ¦ N-msc ¦ 1csNoun Singular Masculine Constructוְandאַפִּangerיmy
  8. עַל'al[will be] onH5921PrepPreposition
  9. תַּבְלִיתָםtav·li·Tamtheir destructionH8399N-fsc ¦ 3mpNoun Singular Feminine Constructתַּבְלִיתָdestructionםtheir
26
  1. וְעוֹרֵרve·'o·Rerand he will wieldH5782Conj-w ¦ V-Piel-ConsecPerf-3msVerb Piel Consecutive Perfect 3rd Singular Masculineוְandעוֹרֵרhe will wield
  2. עָלָיו'a·Lavon itH5921Prep ¦ 3msPrepositionעָלָיonוit
  3. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  4. צְבָאוֹתtze·va·'Otof hostsH6635N-fpNoun Plural Feminine Absolute
  5. שׁוֹטShota whipH7752N-msNoun Singular Masculine Absolute
  6. כְּמַכַּתke·ma·Katlike [the] defeat ofH4347Prep-k ¦ N-fscNoun Singular Feminine Constructכְּlikeמַכַּת[the] defeat of
  7. מִדְיָןmid·YanMidianH4080N-properNoun Proper Location
  8. בְּצוּרbe·Tzurat [the] rock ofH6697Prep-b ¦ N-mscNoun Singular Masculine Constructבְּatצוּר[the] rock of
  9. עוֹרֵבo·RevOrebH6159N-properNoun Proper Location
  10. וּמַטֵּהוּu·ma·Te·huand his staffH4294Conj-w ¦ N-msc ¦ 3msNoun Singular Masculine Constructוּandמַטֵּstaffהוּhis
  11. עַל'al[will be] overH5921PrepPreposition
  12. הַיָּםhai·Yamthe seaH3220Art ¦ N-msNoun Singular Masculine Absoluteהַtheיָּםsea
  13. וּנְשָׂאוֹu·ne·sa·'Oand he will raise itH5375Conj-w ¦ V-Qal-ConsecPerf-3ms ¦ 3msVerb Qal Consecutive Perfect 3rd Singular Masculineוּandנְשָׂאhe will raiseוֹit
  14. בְּדֶרֶךְbe·De·rekhin [the] manner ofH1870Prep-b ¦ N-cscNoun Singular common gender Constructבְּinדֶרֶךְ[the] manner of
  15. מִצְרָיִםmitz·Ra·yimEgyptH4714N-properNoun Proper Location
27
  1. וְהָיָהve·ha·Yahand it will beH1961Conj-w ¦ V-Qal-ConsecPerf-3msVerb Qal Consecutive Perfect 3rd Singular Masculineוְandהָיָהit will be
  2. בַּיּוֹםbai·Yomin the dayH3117Prep-b ¦ N-msNoun Singular Masculine Absoluteבַּin theיּוֹםday
  3. הַהוּאha·Hu'<the> thatH1931Art ¦ Pro-3msPronoun Personal 3rd Singular Masculineהַ<the>הוּאthat
  4. יָסוּרya·Surit will be removedH5493V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  5. סֻבֳּלוֹsu·bo·Loits burdenH5448N-msc ¦ 3msNoun Singular Masculine Constructסֻבֳּלburdenוֹits
  6. מֵעַלme·'Alfrom onH5921Prep-m ¦ PrepPrepositionמֵfromעַלon
  7. שִׁכְמֶךָshikh·Me·khayour shoulderH7926N-msc ¦ 2msNoun Singular Masculine Constructשִׁכְמֶshoulderךָyour
  8. וְעֻלּוֹve·'u·Loand its yokeH5923Conj-w ¦ N-msc ¦ 3msNoun Singular Masculine Constructוְandעֻלּyokeוֹits
  9. מֵעַלme·'Alfrom onH5921Prep-m ¦ PrepPrepositionמֵfromעַלon
  10. צַוָּארֶךָtza·va·Re·khayour neckH6677N-msc ¦ 2msNoun Singular Masculine Constructצַוָּארֶneckךָyour
  11. וְחֻבַּלve·chu·Baland it will be brokenH2254Conj-w ¦ V-Pual-ConsecPerf-3msVerb Pual Consecutive Perfect 3rd Singular Masculineוְandחֻבַּלit will be broken
  12. עֹל'ol[the] yokeH5923N-msNoun Singular Masculine Absolute
  13. מִפְּנֵיmi·pe·nei<from> because ofH6440Prep-m ¦ N-mpcNoun Plural Masculine Constructמִ<from>פְּנֵיbecause of
  14. שָׁמֶןSha·menfatnessH8081N-msNoun Singular Masculine Absolute

Assyria's Advance and Destruction

28
  1. בָּאba'he has comeH935V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  2. עַל'altoH5921PrepPreposition
  3. עַיַּת'ai·YatAiathH5857N-properNoun Proper Location
  4. עָבַר'a·Varhe has passedH5674V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  5. בְּמִגְרוֹןbe·mig·Ronin MigronH4051Prep-b ¦ N-properNoun Proper LocationבְּinמִגְרוֹןMigron
  6. לְמִכְמָשׂle·mikh·Masto MicmashH4363Prep-l ¦ N-properNoun Proper LocationלְtoמִכְמָשׂMicmash
  7. יַפְקִידyaf·Kidhe depositsH6485V-Hiphil-Imperf-3msVerb Hiphil Imperfect 3rd Singular Masculine
  8. כֵּלָיוke·Lavhis baggage<s>H3627N-mpc ¦ 3msNoun Plural Masculine Constructכֵּלָיbaggage<s>וhis
29
  1. עָבְרוּ'a·ve·Ruthey have passed overH5674V-Qal-Perf-3cpVerb Qal Perfect 3rd Plural common gender
  2. מַעְבָּרָהma'·ba·Rah[the] passH4569N-fsNoun Singular Feminine Absolute
  3. גֶּבַעGe·va'GebaH1387N-properNoun Proper Location
  4. מָלוֹןma·Lon[will be] a lodging placeH4411N-msNoun Singular Masculine Absolute
  5. לָנוּLa·nufor usPrep-l ¦ 1cpSuffix Personal 1st Plural common genderלָforנוּus
  6. חָרְדָהcha·re·Dahit has trembledH2729V-Qal-Perf-3fsVerb Qal Perfect 3rd Singular Feminine
  7. הָרָמָהha·ra·Mah<the> RamahH7414Art ¦ N-properNoun Proper Locationהָ<the>רָמָהRamah
  8. גִּבְעַתgiv·'AtGibeah ofH1390N-fscNoun Singular Feminine Construct
  9. שָׁאוּלsha·'UlSaulH7586N-proper-mNoun Proper Masculine
  10. נָסָהNa·sahit has fledH5127V-Qal-Perf-3fsVerb Qal Perfect 3rd Singular Feminine
30
  1. צַהֲלִיtza·ha·Licry aloudH6670V-Piel-Imp-2fsVerb Piel Imperative 2nd Singular Feminine
  2. קוֹלֵךְko·Lekhyour voiceH6963N-msc ¦ 2fsNoun Singular Masculine Constructקוֹלֵvoiceךְyour
  3. בַּתbatO daughter ofH1323N-fscNoun Singular Feminine Construct
  4. גַּלִּיםga·LimGallimH1554N-properNoun Proper Location
  5. הַקְשִׁיבִיhak·Shi·vipay attentionH7181V-Hiphil-Imp-2fsVerb Hiphil Imperative 2nd Singular Feminine
  6. לַיְשָׁהLay·shahO LaishahH3919N-properNoun Proper Location
  7. עֲנִיָּה'a·ni·YahO afflicted [one]H6041Adj-fsAdjective Singular Feminine Absolute
  8. עֲנָתוֹתa·na·TotAnathothH6068N-properNoun Proper Location
31
  1. נָדְדָהna·de·Dahit has fledH5074V-Qal-Perf-3fsVerb Qal Perfect 3rd Singular Feminine
  2. מַדְמֵנָהmad·me·NahMadmenahH4088N-properNoun Proper Location
  3. יֹשְׁבֵיyo·she·Vei[the] inhabitants ofH3427V-Qal-Prtcpl-mpVerb Qal Participle Plural Masculine Construct
  4. הַגֵּבִיםha·ge·Vim<the> GebimH1374Art ¦ N-properNoun Proper Locationהַ<the>גֵּבִיםGebim
  5. הֵעִיזוּhe·'I·zuthey have taken refugeH5756V-Hiphil-Perf-3cpVerb Hiphil Perfect 3rd Plural common gender
32
  1. עוֹדodyetH5750Adj-msAdjective Numerical Singular Masculine Absolute
  2. הַיּוֹםhai·Yomthis dayH3117Art ¦ N-msNoun Singular Masculine Absoluteהַthisיּוֹםday
  3. בְּנֹבbe·Noat NobH5011Prep-b ¦ N-properNoun Proper LocationבְּatנֹבNob
  4. לַעֲמֹדla·'a·Modto standH5975Prep-l ¦ V-Qal-InfVerb Qal Infinitive Constructלַtoעֲמֹדstand
  5. יְנֹפֵףye·no·Fefhe will shakeH5130V-Piel-Imperf-3msVerb Piel Imperfect 3rd Singular Masculine
  6. יָדוֹya·Dohis handH3027N-csc ¦ 3msNoun Singular common gender Constructיָדhandוֹhis
  7. הַרhar[the] mountain ofH2022N-mscNoun Singular Masculine Construct
  8. בַּתbeit[the] daughter ofH1323N-fscNoun Singular Feminine Construct
  9. צִיּוֹןtzi·YonZionH6726N-properNoun Proper Location
  10. גִּבְעַתgiv·'At[the] hill ofH1389N-fscNoun Singular Feminine Construct
  11. יְרוּשָׁלִָםye·ru·sha·LimJerusalemH3389N-properNoun Proper Location
33
  1. הִנֵּהhi·Nehthere!H2009PrtParticle Interjection
  2. הָאָדוֹןha·'a·dOnthe lordH113Art ¦ N-msNoun Singular Masculine Absoluteהָtheאָדוֹןlord
  3. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  4. צְבָאוֹתtze·va·'otof hostsH6635N-fpNoun Plural Feminine Absolute
  5. מְסָעֵףme·sa·'Ef[is] about to lop offH5586V-Piel-Prtcpl-msVerb Piel Participle Singular Masculine Absolute
  6. פֻּארָהpu·Rahbough[s]H6288N-fsNoun Singular Feminine Absolute
  7. בְּמַעֲרָצָהbe·ma·'a·ra·Tzahwith a crashH4637Prep-b ¦ N-fsNoun Singular Feminine Absoluteבְּwithמַעֲרָצָהa crash
  8. וְרָמֵיve·ra·Meiand [the] exalted [ones] ofH7311Conj-w ¦ V-Qal-Prtcpl-mpVerb Qal Participle Plural Masculine Constructוְandרָמֵי[the] exalted [ones] of
  9. הַקּוֹמָהha·ko·Mah<the> heightH6967Art ¦ N-fsNoun Singular Feminine Absoluteהַ<the>קּוֹמָהheight
  10. גְּדוּעִיםge·du·'Im[will be] cut downH1438V-Qal-PassPrtcpl-mpVerb Qal Participle Passive Plural Masculine Absolute
  11. וְהַגְּבֹהִיםve·ha·ge·vo·Himand the tall [ones]H1364Conj-w ¦ Art ¦ Adj-mpAdjective Plural Masculine Absoluteוְandהַtheגְּבֹהִיםtall [ones]
  12. יִשְׁפָּלוּyish·Pa·luthey will become lowH8213V-Qal-Imperf-3mpVerb Qal Imperfect 3rd Plural Masculine
34
  1. וְנִקַּףve·ni·Kafand he will cut downH5362Conj-w ¦ V-Piel-ConsecPerf-3msVerb Piel Consecutive Perfect 3rd Singular Masculineוְandנִקַּףhe will cut down
  2. סִבְכֵיsiv·Khei[the] thickets ofH5442N-mpcNoun Plural Masculine Construct
  3. הַיַּעַרhai·Ya·'arthe forestH3293Art ¦ N-msNoun Singular Masculine Absoluteהַtheיַּעַרforest
  4. בַּבַּרְזֶלba·bar·Zelwith <the> iron [axe]H1270Prep-b ¦ N-msNoun Singular Masculine Absoluteבַּwith <the>בַּרְזֶלiron [axe]
  5. וְהַלְּבָנוֹןve·ha·le·va·Nonand the LebanonH3844Conj-w ¦ Art ¦ N-properNoun Proper LocationוְandהַtheלְּבָנוֹןLebanon
  6. בְּאַדִּירbe·'a·Dirby a mighty [one]H117Prep-b ¦ Adj-msAdjective Singular Masculine Absoluteבְּbyאַדִּירa mighty [one]
  7. יִפּוֹלyi·Polit will fallH5307V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
English is a literal word-by-word gloss of the Hebrew, not the KJV's wording. Why?

This is the original text the KJV's translators worked from — each Hebrew word with its own literal English meaning in this verse, prepared by scholars at Tyndale House, Cambridge. The KJV translates whole sentences, not word by word, so its wording differs: one Hebrew word can become several English words, and the KJV may choose “the LORD” where the gloss reads “Yahweh”. Both are faithful — they answer different questions. For the KJV's own rendering, switch to the KJV text.

Use ← → arrow keys to navigate
Settings

Reading Style

Typeface

Font Size 19px

Reading Width 90 chars

Options