English · KJV

Isaiah24

Listen to this chapter
0:00 0:00
256 Hebrew words

The Lord's Universal Judgment

1
  1. הִנֵּהhi·Nehhere!H2009PrtParticle Interjection
  2. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  3. בּוֹקֵקbo·Kek[is] about to lay wasteH1238V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absolute
  4. הָאָרֶץha·'A·retzthe earthH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץearth
  5. וּבוֹלְקָהּu·Vol·Kahand [is] about to devastate itH1110Conj-w ¦ V-Qal-Prtcpl-ms ¦ 3fsVerb Qal Participle Singular Masculine Constructוּandבוֹלְקָ[is] about to devastateהּit
  6. וְעִוָּהve·'i·Vahand he will twistH5753Conj-w ¦ V-Piel-ConsecPerf-3msVerb Piel Consecutive Perfect 3rd Singular Masculineוְandעִוָּהhe will twist
  7. פָנֶיהָfa·Nei·haits surfaceH6440N-mpc ¦ 3fsNoun Plural Masculine Constructפָנֶיsurfaceהָits
  8. וְהֵפִיץve·he·Fitzand he will scatterH6327Conj-w ¦ V-Hiphil-ConsecPerf-3msVerb Hiphil Consecutive Perfect 3rd Singular Masculineוְandהֵפִיץhe will scatter
  9. יֹשְׁבֶיהָyo·she·Vei·haits inhabitantsH3427V-Qal-Prtcpl-mp ¦ 3fsVerb Qal Participle Plural Masculine Constructיֹשְׁבֶיinhabitantsהָits
2
  1. וְהָיָהve·ha·Yahand it will beH1961Conj-w ¦ V-Qal-ConsecPerf-3msVerb Qal Consecutive Perfect 3rd Singular Masculineוְandהָיָהit will be
  2. כָעָםkha·'Amas the peopleH5971Prep-k ¦ N-msNoun Singular Masculine Absoluteכָas theעָםpeople
  3. כַּכֹּהֵןka·ko·Henas the priestH3548Prep-k ¦ N-msNoun Singular Masculine Absoluteכַּas theכֹּהֵןpriest
  4. כַּעֶבֶדka·'E·vedas the servantH5650Prep-k ¦ N-msNoun Singular Masculine Absoluteכַּas theעֶבֶדservant
  5. כַּאדֹנָיוka·do·Navas his master<s>H113Prep-k ¦ N-mpc ¦ 3msNoun Plural Masculine Constructכַּasאדֹנָיmaster<s>וhis
  6. כַּשִּׁפְחָהka·shif·Chahas the maidservantH8198Prep-k ¦ N-fsNoun Singular Feminine Absoluteכַּas theשִּׁפְחָהmaidservant
  7. כַּגְּבִרְתָּהּka·ge·vir·Tahas <the> her mistressH1404Prep-k ¦ N-fsc ¦ 3fsNoun Singular Feminine Constructכַּas <the>גְּבִרְתָּmistressהּher
  8. כַּקּוֹנֶהka·ko·Nehas the buyerH7069Prep-k ¦ V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absoluteכַּas theקּוֹנֶהbuyer
  9. כַּמּוֹכֵרka·mo·Kheras the sellerH4376Prep-k ¦ V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absoluteכַּas theמּוֹכֵרseller
  10. כַּמַּלְוֶהka·mal·Vehas the lenderH3867Prep-k ¦ V-Hiphil-Prtcpl-msVerb Hiphil Participle Singular Masculine Absoluteכַּas theמַּלְוֶהlender
  11. כַּלֹּוֶהka·lo·Vehas the borrowerH3867Prep-k ¦ V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absoluteכַּas theלֹּוֶהborrower
  12. כַּנֹּשֶׁהka·no·Shehas the creditorH5383Prep-k ¦ V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absoluteכַּas theנֹּשֶׁהcreditor
  13. כַּאֲשֶׁרka·'a·Sheras [the one] whoH834Prep-k ¦ RelParticle Relativeכַּasאֲשֶׁר[the one] who
  14. נֹשֶׁאno·She'a creditorH5378V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absolute
  15. בוֹvo[is] in himPrep-b ¦ 3msSuffix Personal 3rd Singular Masculineב[is] inוֹhim
3
  1. הִבּוֹקhi·Bokcertainly <to be laid waste>H1238V-Niphal-InfAbsVerb Niphal Infinitive Absolute
  2. תִּבּוֹקti·Bokit will be laid wasteH1238V-Niphal-Imperf-3fsVerb Niphal Imperfect 3rd Singular Feminine
  3. הָאָרֶץha·'A·retzthe earthH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץearth
  4. וְהִבּוֹזve·hi·Bozand certainly <to be plundered>H962Conj-w ¦ V-Niphal-InfAbsVerb Niphal Infinitive Absoluteוְandהִבּוֹזcertainly <to be plundered>
  5. תִּבּוֹזti·Bozit will be plunderedH962V-Niphal-Imperf-3fsVerb Niphal Imperfect 3rd Singular Feminine
  6. כִּיkiforH3588PrtParticle Conditional
  7. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  8. דִּבֶּרdi·Berhe has spokenH1696V-Piel-Perf-3msVerb Piel Perfect 3rd Singular Masculine
  9. אֶת'et<obj.>H853DirObjMParticle Object Indicator
  10. הַדָּבָרha·da·Varthe wordH1697Art ¦ N-msNoun Singular Masculine Absoluteהַtheדָּבָרword
  11. הַזֶּהha·Zeh<the> thisH2088Art ¦ PrtParticle Demonstrativeהַ<the>זֶּהthis
4
  1. אָבְלָה'a·ve·Lahit has dried upH56V-Qal-Perf-3fsVerb Qal Perfect 3rd Singular Feminine
  2. נָבְלָהna·ve·Lahit has witheredH5034V-Qal-Perf-3fsVerb Qal Perfect 3rd Singular Feminine
  3. הָאָרֶץha·'A·retzthe earthH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץearth
  4. אֻמְלְלָה'um·le·Lahit has languishedH535V-Pual-Perf-3fsVerb Pual Perfect 3rd Singular Feminine
  5. נָבְלָהna·ve·Lahit has witheredH5034V-Qal-Perf-3fsVerb Qal Perfect 3rd Singular Feminine
  6. תֵּבֵלte·Vel[the] worldH8398N-fsNoun Singular Feminine Absolute
  7. אֻמְלָלוּ'um·La·luthey have languishedH535V-Pual-Perf-3cpVerb Pual Perfect 3rd Plural common gender
  8. מְרוֹםme·Rom[the] noble[s] ofH4791N-mscNoun Singular Masculine Construct
  9. עַם'am[the] people ofH5971N-mscNoun Singular Masculine Construct
  10. הָאָרֶץha·'A·retzthe earthH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץearth
5
  1. וְהָאָרֶץve·ha·'A·retzand the earthH776Conj-w ¦ Art ¦ N-fsNoun Singular Feminine Absoluteוְandהָtheאָרֶץearth
  2. חָנְפָהcha·ne·Fahit has been pollutedH2610V-Qal-Perf-3fsVerb Qal Perfect 3rd Singular Feminine
  3. תַּחַתTa·chatunderH8478N-mscNoun Singular Masculine Construct
  4. יֹשְׁבֶיהָyo·she·Vei·haits inhabitantsH3427V-Qal-Prtcpl-mp ¦ 3fsVerb Qal Participle Plural Masculine Constructיֹשְׁבֶיinhabitantsהָits
  5. כִּיkiforH3588PrtParticle Conditional
  6. עָבְרוּ'a·ve·Ruthey have transgressedH5674V-Qal-Perf-3cpVerb Qal Perfect 3rd Plural common gender
  7. תוֹרֹתto·RotlawsH8451N-fpNoun Plural Feminine Absolute
  8. חָלְפוּChal·futhey have oversteppedH2498V-Qal-Perf-3cpVerb Qal Perfect 3rd Plural common gender
  9. חֹקChok[the] decreeH2706N-msNoun Singular Masculine Absolute
  10. הֵפֵרוּhe·Fe·ruthey have brokenH6565V-Hiphil-Perf-3cpVerb Hiphil Perfect 3rd Plural common gender
  11. בְּרִיתbe·Rit[the] covenant ofH1285N-fscNoun Singular Feminine Construct
  12. עוֹלָםo·LamperpetuityH5769N-msNoun Singular Masculine Absolute
6
  1. עַל'althere-H5921PrepPreposition
  2. כֵּןKen-foreH3651AdvAdverb
  3. אָלָה'a·Laha curseH423N-fsNoun Singular Feminine Absolute
  4. אָכְלָה'A·khe·lahit has consumedH398V-Qal-Perf-3fsVerb Qal Perfect 3rd Singular Feminine
  5. אֶרֶץ'E·retz[the] earthH776N-fsNoun Singular Feminine Absolute
  6. וַיֶּאְשְׁמוּvai·ye'·she·Muand they have been held guiltyH816Conj-w ¦ V-Qal-ConsecImperf-3mpVerb Qal Consecutive Imperfect 3rd Plural Masculineוַandיֶּאְשְׁמוּthey have been held guilty
  7. יֹשְׁבֵיYo·she·vei[the] inhabitantsH3427V-Qal-Prtcpl-mpVerb Qal Participle Plural Masculine Construct
  8. בָהּVahin <the> itPrep-b ¦ 3fsSuffix Personal 3rd Singular Feminineבָin <the>הּit
  9. עַל'althere-H5921PrepPreposition
  10. כֵּןKen-foreH3651AdvAdverb
  11. חָרוּcha·Ruthey have diminishedH2787V-Qal-Perf-3cpVerb Qal Perfect 3rd Plural common gender
  12. יֹשְׁבֵיYo·she·vei[the] inhabitants ofH3427V-Qal-Prtcpl-mpVerb Qal Participle Plural Masculine Construct
  13. אֶרֶץ'E·retz[the] earthH776N-fsNoun Singular Feminine Absolute
  14. וְנִשְׁאַרve·nish·'Arand it will be leftH7604Conj-w ¦ V-Niphal-ConsecPerf-3msVerb Niphal Consecutive Perfect 3rd Singular Masculineוְandנִשְׁאַרit will be left
  15. אֱנוֹשׁ'e·No·oshhumankind ofH582N-mscNoun Singular Masculine Construct
  16. מִזְעָרmiz·'ArsmallnessH4213N-msNoun Singular Masculine Absolute

The End of Joy and Celebration

7
  1. אָבַל'a·Valit has dried upH56V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  2. תִּירוֹשׁti·Ro·oshnew wineH8492N-msNoun Singular Masculine Absolute
  3. אֻמְלְלָה'um·le·lahit has languishedH535V-Pual-Perf-3fsVerb Pual Perfect 3rd Singular Feminine
  4. גָפֶןGa·fen[the] vineH1612N-csNoun Singular common gender Absolute
  5. נֶאֶנְחוּne·'en·Chuthey have groanedH584V-Niphal-Perf-3cpVerb Niphal Perfect 3rd Plural common gender
  6. כָּלkolallH3605N-mscNoun Singular Masculine Construct
  7. שִׂמְחֵיsim·chei[the people] joyful ofH8056Adj-mpcAdjective Plural Masculine Construct
  8. לֵבLevheartH3820N-msNoun Singular Masculine Absolute
8
  1. שָׁבַתsha·Vatit has ceasedH7673V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  2. מְשׂוֹשׂme·Sos[the] gaiety ofH4885N-mscNoun Singular Masculine Construct
  3. תֻּפִּיםtu·PimtambourinesH8596N-mpNoun Plural Masculine Absolute
  4. חָדַלcha·Dalit has stoppedH2308V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  5. שְׁאוֹןshe·'on[the] uproar ofH7588N-mscNoun Singular Masculine Construct
  6. עַלִּיזִים'a·li·Zimjubilant [people]H5947Adj-mpAdjective Plural Masculine Absolute
  7. שָׁבַתsha·Vatit has ceasedH7673V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  8. מְשׂוֹשׂme·Sos[the] gaiety ofH4885N-mscNoun Singular Masculine Construct
  9. כִּנּוֹרki·Nor[the] harpH3658N-msNoun Singular Masculine Absolute
9
  1. בַּשִּׁירba·Shirwith <the> songH7892Prep-b ¦ N-msNoun Singular Masculine Absoluteבַּwith <the>שִּׁירsong
  2. לֹאlo'notH3808NegParticle Negative
  3. יִשְׁתּוּyish·tupeople will drinkH8354V-Qal-Imperf-3mpVerb Qal Imperfect 3rd Plural Masculine
  4. יָיִןYa·yinwineH3196N-msNoun Singular Masculine Absolute
  5. יֵמַרye·Marit will be bitterH4843V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  6. שֵׁכָרshe·Kharstrong drinkH7941N-msNoun Singular Masculine Absolute
  7. לְשֹׁתָיוle·sho·Tavto [those who] drink itH8354Prep-l ¦ V-Qal-Prtcpl-mp ¦ 3msVerb Qal Participle Plural Masculine Constructלְtoשֹׁתָי[those who] drinkוit
10
  1. נִשְׁבְּרָהnish·be·Rahit has been brokenH7665V-Niphal-Perf-3fsVerb Niphal Perfect 3rd Singular Feminine
  2. קִרְיַתkir·yat[the] town ofH7151N-fscNoun Singular Feminine Construct
  3. תֹּהוּTo·huformlessnessH8414N-msNoun Singular Masculine Absolute
  4. סֻגַּרsu·Garit has been shut upH5462V-Pual-Perf-3msVerb Pual Perfect 3rd Singular Masculine
  5. כָּלkoleveryH3605N-mscNoun Singular Masculine Construct
  6. בַּיִתBa·yithouseH1004N-msNoun Singular Masculine Absolute
  7. מִבּוֹאmi·Bo'from enteringH935Prep-m ¦ V-Qal-InfVerb Qal Infinitive Constructמִfromבּוֹאentering
11
  1. צְוָחָהtze·va·Chahan outcryH6682N-fsNoun Singular Feminine Absolute
  2. עַל'alonH5921PrepPreposition
  3. הַיַּיִןhai·Ya·yin<the> wineH3196Art ¦ N-msNoun Singular Masculine Absoluteהַ<the>יַּיִןwine
  4. בַּחוּצוֹתba·chu·Tzot[will be] in the streetsH2351Prep-b ¦ N-fpNoun Plural Feminine Absoluteבַּ[will be] in theחוּצוֹתstreets
  5. עָרְבָה'a·re·Vahit has become eveningH6150V-Qal-Perf-3fsVerb Qal Perfect 3rd Singular Feminine
  6. כָּלkolallH3605N-mscNoun Singular Masculine Construct
  7. שִׂמְחָהsim·ChahgladnessH8057N-fsNoun Singular Feminine Absolute
  8. גָּלָהga·Lahit has departedH1540V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  9. מְשׂוֹשׂme·Sos[the] gaiety ofH4885N-mscNoun Singular Masculine Construct
  10. הָאָרֶץha·'A·retzthe earthH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץearth
12
  1. נִשְׁאַרnish·'Arit has remainedH7604V-Niphal-Perf-3msVerb Niphal Perfect 3rd Singular Masculine
  2. בָּעִירba·'Irin the cityH5892Prep-b ¦ N-fsNoun Singular Feminine Absoluteבָּin theעִירcity
  3. שַׁמָּהsha·MahdesolationH8047N-fsNoun Singular Feminine Absolute
  4. וּשְׁאִיָּהu·she·'i·Yahand ruinH7591Conj-w ¦ N-fsNoun Singular Feminine Absoluteוּandשְׁאִיָּהruin
  5. יֻכַּתyu·katit will be crushedH3807V-Hophal-Imperf-3msVerb Hophal Imperfect 3rd Singular Masculine
  6. שָׁעַרSha·'ar[the] gateH8179N-msNoun Singular Masculine Absolute

A Remnant Praises the Lord

13
  1. כִּיkiforH3588PrtParticle Conditional
  2. כֹהkhohthusH3541AdvAdverb
  3. יִהְיֶהyih·Yehit will beH1961V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  4. בְּקֶרֶבbe·Ke·revin [the] midst ofH7130Prep-b ¦ N-mscNoun Singular Masculine Constructבְּinקֶרֶב[the] midst of
  5. הָאָרֶץha·'A·retzthe earthH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץearth
  6. בְּתוֹךְbe·Tokhin amongH8432Prep-b ¦ N-mscNoun Singular Masculine Constructבְּinתוֹךְamong
  7. הָעַמִּיםha·'a·Mimthe peoplesH5971Art ¦ N-mpNoun Plural Masculine Absoluteהָtheעַמִּיםpeoples
  8. כְּנֹקֶףke·No·keflike [the] beating ofH5363Prep-k ¦ N-mscNoun Singular Masculine Constructכְּlikeנֹקֶף[the] beating of
  9. זַיִתZa·yitan olive treeH2132N-msNoun Singular Masculine Absolute
  10. כְּעוֹלֵלֹתke·'o·le·Lotlike gleaningsH5955Prep-k ¦ N-fpNoun Plural Feminine Absoluteכְּlikeעוֹלֵלֹתgleanings
  11. אִם'imifH518PrtParticle Conditional
  12. כָּלָהka·Lahit has come to an endH3615V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  13. בָצִירva·Tzir[the] grape harvestH1210N-msNoun Singular Masculine Absolute
14
  1. הֵמָּהHe·mahtheyH1992Pro-3mpPronoun Personal 3rd Plural Masculine
  2. יִשְׂאוּyis·'Uthey will lift upH5375V-Qal-Imperf-3mpVerb Qal Imperfect 3rd Plural Masculine
  3. קוֹלָםko·Lamtheir voiceH6963N-msc ¦ 3mpNoun Singular Masculine Constructקוֹלָvoiceםtheir
  4. יָרֹנּוּya·Ro·nuthey will shout for joyH7442V-Qal-Imperf-3mpVerb Qal Imperfect 3rd Plural Masculine
  5. בִּגְאוֹןbig·'onin [the] majesty ofH1347Prep-b ¦ N-mscNoun Singular Masculine Constructבִּinגְאוֹן[the] majesty of
  6. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  7. צָהֲלוּtza·ha·Luthey will cry aloudH6670V-Qal-Perf-3cpVerb Qal Perfect 3rd Plural common gender
  8. מִיָּםmi·Yamfrom [the] westH3220Prep-m ¦ N-msNoun Singular Masculine Absoluteמִfromיָּם[the] west
15
  1. עַל'althere-H5921PrepPreposition
  2. כֵּןken-foreH3651AdvAdverb
  3. בָּאֻרִיםba·'u·Rimin the eastH217Prep-b ¦ N-mpNoun Plural Masculine Absoluteבָּin theאֻרִיםeast
  4. כַּבְּדוּka·be·DuglorifyH3513V-Piel-Imp-2mpVerb Piel Imperative 2nd Plural Masculine
  5. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  6. בְּאִיֵּיbe·'i·Yeiin [the] islands ofH339Prep-b ¦ N-mpcNoun Plural Masculine Constructבְּinאִיֵּי[the] islands of
  7. הַיָּםhai·Yamthe seaH3220Art ¦ N-msNoun Singular Masculine Absoluteהַtheיָּםsea
  8. שֵׁםshem[the] name ofH8034N-mscNoun Singular Masculine Construct
  9. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  10. אֱלֹהֵי'e·lo·Hei[the] God ofH430N-mpcNoun Plural Masculine Construct
  11. יִשְׂרָאֵלYis·ra·'ElIsraelH3478N-properNoun Proper Location
16
  1. מִכְּנַףmi·ke·Naffrom [the] extremity ofH3671Prep-m ¦ N-fscNoun Singular Feminine Constructמִfromכְּנַף[the] extremity of
  2. הָאָרֶץha·'A·retzthe earthH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץearth
  3. זְמִרֹתze·mi·RotsongsH2158N-fpNoun Plural Feminine Absolute
  4. שָׁמַעְנוּsha·Ma'·nuwe have heardH8085V-Qal-Perf-1cpVerb Qal Perfect 1st Plural common gender
  5. צְבִיtze·VisplendorH6643N-msNoun Singular Masculine Absolute
  6. לַצַּדִּיקla·tza·Dik[belongs] to the righteous [one]H6662Prep-l ¦ Adj-msAdjective Singular Masculine Absoluteלַ[belongs] to theצַּדִּיקrighteous [one]
  7. וָאֹמַרva·'o·Marand I saidH559Conj-w ¦ V-Qal-ConsecImperf-1csVerb Qal Consecutive Imperfect 1st Singular common genderוָandאֹמַרI said
  8. רָזִיra·zileannessH7334N-msNoun Singular Masculine Absolute
  9. לִיli[belongs] to mePrep-l ¦ 1csSuffix Personal 1st Singular common genderלִ[belongs] toיme
  10. רָזִיra·zileannessH7334N-msNoun Singular Masculine Absolute
  11. לִיli[belongs] to mePrep-l ¦ 1csSuffix Personal 1st Singular common genderלִ[belongs] toיme
  12. אוֹי'owoe!H188PrtParticle Interjection
  13. לִיLito mePrep-l ¦ 1csSuffix Personal 1st Singular common genderלִtoיme
  14. בֹּגְדִיםbo·ge·Dim[those who] act treacherouslyH898V-Qal-Prtcpl-mpVerb Qal Participle Plural Masculine Absolute
  15. בָּגָדוּba·Ga·duthey act treacherouslyH898V-Qal-Perf-3cpVerb Qal Perfect 3rd Plural common gender
  16. וּבֶגֶדu·Ve·gedand treacheryH899Conj-w ¦ N-msNoun Singular Masculine Absoluteוּandבֶגֶדtreachery
  17. בּוֹגְדִיםbog·Dim[those who] act treacherouslyH898V-Qal-Prtcpl-mpVerb Qal Participle Plural Masculine Absolute
  18. בָּגָדוּba·Ga·duthey act treacherouslyH898V-Qal-Perf-3cpVerb Qal Perfect 3rd Plural common gender

Inescapable Terror and Cosmic Collapse

17
  1. פַּחַדPa·chaddreadH6343N-msNoun Singular Masculine Absolute
  2. וָפַחַתva·Fa·chatand pitH6354Conj-w ¦ N-msNoun Singular Masculine Absoluteוָandפַחַתpit
  3. וָפָחva·Fachand snareH6341Conj-w ¦ N-msNoun Singular Masculine Absoluteוָandפָחsnare
  4. עָלֶיךָ'a·Lei·kha[are] on youH5921Prep ¦ 2msPrepositionעָלֶי[are] onךָyou
  5. יוֹשֵׁבyo·ShevO inhabitant ofH3427V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Construct
  6. הָאָרֶץha·'A·retzthe earthH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץearth
18
  1. וְהָיָהVe·ha·yahand it will beH1961Conj-w ¦ V-Qal-ConsecPerf-3msVerb Qal Consecutive Perfect 3rd Singular Masculineוְandהָיָהit will be
  2. הַנָּסha·Nasthe [one who] fleesH5127Art ¦ V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absoluteהַtheנָּס[one who] flees
  3. מִקּוֹלmi·Kolfrom [the] sound ofH6963Prep-m ¦ N-mscNoun Singular Masculine Constructמִfromקּוֹל[the] sound of
  4. הַפַּחַדha·Pa·chadthe dreadH6343Art ¦ N-msNoun Singular Masculine Absoluteהַtheפַּחַדdread
  5. יִפֹּלyi·Polhe will fallH5307V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  6. אֶל'elintoH413PrepPreposition
  7. הַפַּחַתha·Pa·chatthe pitH6354Art ¦ N-msNoun Singular Masculine Absoluteהַtheפַּחַתpit
  8. וְהָעוֹלֶהve·ha·'o·Lehand the [one who] goes upH5927Conj-w ¦ Art ¦ V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absoluteוְandהָtheעוֹלֶה[one who] goes up
  9. מִתּוֹךְmi·Tokhfrom [the] midst ofH8432Prep-m ¦ N-mscNoun Singular Masculine Constructמִfromתּוֹךְ[the] midst of
  10. הַפַּחַתha·Pa·chatthe pitH6354Art ¦ N-msNoun Singular Masculine Absoluteהַtheפַּחַתpit
  11. יִלָּכֵדyi·la·Khedhe will be caughtH3920V-Niphal-Imperf-3msVerb Niphal Imperfect 3rd Singular Masculine
  12. בַּפָּחba·Pachin <the> snareH6341Prep-b ¦ N-msNoun Singular Masculine Absoluteבַּin <the>פָּחsnare
  13. כִּיkiforH3588PrtParticle Conditional
  14. אֲרֻבּוֹת'a·ru·BotwindowsH699N-fpNoun Plural Feminine Absolute
  15. מִמָּרוֹםmi·ma·rOmfrom a high placeH4791Prep-m ¦ N-msNoun Singular Masculine Absoluteמִfromמָּרוֹםa high place
  16. נִפְתָּחוּnif·Ta·chuthey have been openedH6605V-Niphal-Perf-3cpVerb Niphal Perfect 3rd Plural common gender
  17. וַיִּרְעֲשׁוּvai·yir·'a·Shuand they have shakenH7493Conj-w ¦ V-Qal-ConsecImperf-3mpVerb Qal Consecutive Imperfect 3rd Plural Masculineוַandיִּרְעֲשׁוּthey have shaken
  18. מוֹסְדֵיMos·dei[the] foundations ofH4144N-mpcNoun Plural Masculine Construct
  19. אָרֶץ'A·retz[the] earthH776N-fsNoun Singular Feminine Absolute
19
  1. רֹעָהRo·'ahutterly <broken>H7489V-Qal-Prtcpl-fsVerb Qal Participle Singular Feminine Absolute
  2. הִתְרֹעֲעָהhit·ro·'a·'Ahit has been brokenH7489V-Hithpael-Perf-3fsVerb Hithpael Perfect 3rd Singular Feminine
  3. הָאָרֶץha·'A·retzthe earthH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץearth
  4. פּוֹרPorutterly <split>H6565V-Qal-InfVerb Qal Infinitive Construct
  5. הִתְפּוֹרְרָהhit·po·Rahit has been split throughH6565V-Hithpael-Perf-3fsVerb Hithpael Perfect 3rd Singular Feminine
  6. אֶרֶץ'E·retz[the] earthH776N-fsNoun Singular Feminine Absolute
  7. מוֹטMotcertainly <to shake>H4131V-Qal-InfAbsVerb Qal Infinitive Absolute
  8. הִתְמוֹטְטָהhit·mo·Tahit has been shakenH4131V-Hithpael-Perf-3fsVerb Hithpael Perfect 3rd Singular Feminine
  9. אָרֶץ'A·retz[the] earthH776N-fsNoun Singular Feminine Absolute
20
  1. נוֹעַNo·a'wildly <stagger>H5128V-Qal-InfVerb Qal Infinitive Construct
  2. תָּנוּעַta·Nu·a'it will staggerH5128V-Qal-Imperf-3fsVerb Qal Imperfect 3rd Singular Feminine
  3. אֶרֶץ'e·retz[the] earthH776N-fsNoun Singular Feminine Absolute
  4. כַּשִּׁכּוֹרka·shi·Korlike <the> drunkardH7910Prep-k ¦ Adj-msAdjective Singular Masculine Absoluteכַּlike <the>שִּׁכּוֹרdrunkard
  5. וְהִתְנוֹדְדָהve·hit·no·Dahand it will swayH5110Conj-w ¦ V-Hithpael-ConsecPerf-3fsVerb Hithpael Consecutive Perfect 3rd Singular Feminineוְandהִתְנוֹדְדָהit will sway
  6. כַּמְּלוּנָהka·me·lu·Nahlike <the> hutH4412Prep-k ¦ N-fsNoun Singular Feminine Absoluteכַּlike <the>מְּלוּנָהhut
  7. וְכָבַדve·kha·Vadand it will be heavyH3513Conj-w ¦ V-Qal-ConsecPerf-3msVerb Qal Consecutive Perfect 3rd Singular Masculineוְandכָבַדit will be heavy
  8. עָלֶיהָ'a·Lei·haon itH5921Prep ¦ 3fsPreposition Definiteעָלֶיonהָit
  9. פִּשְׁעָהּpish·'Ahits transgressionH6588N-msc ¦ 3fsNoun Singular Masculine Constructפִּשְׁעָtransgressionהּits
  10. וְנָפְלָהve·na·fe·Lahand it will fallH5307Conj-w ¦ V-Qal-ConsecPerf-3fsVerb Qal Consecutive Perfect 3rd Singular Feminineוְandנָפְלָהit will fall
  11. וְלֹאve·lo'and notH3808Conj-w ¦ NegParticle Negativeוְandלֹאnot
  12. תֹסִיףto·Sifit will repeatH3254V-Hiphil-Imperf-3fsVerb Hiphil Imperfect 3rd Singular Feminine
  13. קוּםKumto riseH6965V-Qal-InfVerb Qal Infinitive Construct

Yahweh Judges All Powers

21
  1. וְהָיָהve·ha·Yahand it will beH1961Conj-w ¦ V-Qal-ConsecPerf-3msVerb Qal Consecutive Perfect 3rd Singular Masculineוְandהָיָהit will be
  2. בַּיּוֹםbai·Yomin the dayH3117Prep-b ¦ N-msNoun Singular Masculine Absoluteבַּin theיּוֹםday
  3. הַהוּאha·Hu'<the> thatH1931Art ¦ Pro-3msPronoun Personal 3rd Singular Masculineהַ<the>הוּאthat
  4. יִפְקֹדyif·Kodhe will visit [judgment]H6485V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  5. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  6. עַל'alonH5921PrepPreposition
  7. צְבָאtze·Va'[the] host ofH6635N-mscNoun Singular Masculine Construct
  8. הַמָּרוֹםha·ma·Romthe heightH4791Art ¦ N-msNoun Singular Masculine Absoluteהַtheמָּרוֹםheight
  9. בַּמָּרוֹםba·ma·Romin the height[s]H4791Prep-b ¦ N-msNoun Singular Masculine Absoluteבַּin theמָּרוֹםheight[s]
  10. וְעַלve·'aland onH5921Conj-w ¦ PrepPrepositionוְandעַלon
  11. מַלְכֵיmal·Khei[the] kings ofH4428N-mpcNoun Plural Masculine Construct
  12. הָאֲדָמָהha·'a·da·Mahthe earthH127Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאֲדָמָהearth
  13. עַל'alonH5921PrepPreposition
  14. הָאֲדָמָהha·'a·da·Mahthe earthH127Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאֲדָמָהearth
22
  1. וְאֻסְּפוּve·'u·se·Fuand they will be gatheredH622Conj-w ¦ V-Pual-ConsecPerf-3cpVerb Pual Consecutive Perfect 3rd Plural common genderוְandאֻסְּפוּthey will be gathered
  2. אֲסֵפָה'a·se·Faha gatheringH626N-fsNoun Singular Feminine Absolute
  3. אַסִּיר'a·Sirprisoner[s]H616N-msNoun Singular Masculine Absolute
  4. עַל'altoH5921PrepPreposition
  5. בּוֹרBora pitH953N-msNoun Singular Masculine Absolute
  6. וְסֻגְּרוּve·su·ge·Ruand they will be shut upH5462Conj-w ¦ V-Pual-ConsecPerf-3cpVerb Pual Consecutive Perfect 3rd Plural common genderוְandסֻגְּרוּthey will be shut up
  7. עַל'alatH5921PrepPreposition
  8. מַסְגֵּרmas·Gera prisonH4525N-msNoun Singular Masculine Absolute
  9. וּמֵרֹבu·me·Roand from an abundance ofH7230Conj-w ¦ Prep-m ¦ N-mscNoun Singular Masculine Constructוּandמֵfromרֹבan abundance of
  10. יָמִיםya·MimdaysH3117N-mpNoun Plural Masculine Absolute
  11. יִפָּקֵדוּyi·pa·Ke·duthey will be visitedH6485V-Niphal-Imperf-3mpVerb Niphal Imperfect 3rd Plural Masculine
23
  1. וְחָפְרָהve·cha·fe·Rahand it will be abashedH2659Conj-w ¦ V-Qal-ConsecPerf-3fsVerb Qal Consecutive Perfect 3rd Singular Feminineוְandחָפְרָהit will be abashed
  2. הַלְּבָנָהha·le·va·Nahthe moonH3842Art ¦ N-fsNoun Singular Feminine Absoluteהַtheלְּבָנָהmoon
  3. וּבוֹשָׁהu·vo·Shahand it will be ashamedH954Conj-w ¦ V-Qal-ConsecPerf-3fsVerb Qal Consecutive Perfect 3rd Singular Feminineוּandבוֹשָׁהit will be ashamed
  4. הַחַמָּהha·cha·Mahthe sunH2535Art ¦ N-fsNoun Singular Feminine Absoluteהַtheחַמָּהsun
  5. כִּיkiforH3588PrtParticle Conditional
  6. מָלַךְma·Lakhhe will reignH4427V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  7. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  8. צְבָאוֹתtze·va·'otof hostsH6635N-fpNoun Plural Feminine Absolute
  9. בְּהַרbe·Haron [the] mountain ofH2022Prep-b ¦ N-mscNoun Singular Masculine Constructבְּonהַר[the] mountain of
  10. צִיּוֹןtzi·yOnZionH6726N-properNoun Proper Location
  11. וּבִירוּשָׁלִַםu·vi·Ru·sha·Limand in JerusalemH3389Conj-w ¦ Prep-b ¦ N-properNoun Proper LocationוּandבִinירוּשָׁלִַםJerusalem
  12. וְנֶגֶדve·Ne·gedand beforeH5048Conj-w ¦ Adj-mscAdjective Numerical Singular Masculine Constructוְandנֶגֶדbefore
  13. זְקֵנָיוze·ke·Navhis eldersH2205Adj-mpc ¦ 3msAdjective Plural Masculine Constructזְקֵנָיeldersוhis
  14. כָּבוֹדka·VodgloryH3519N-msNoun Singular Masculine Absolute
English is a literal word-by-word gloss of the Hebrew, not the KJV's wording. Why?

This is the original text the KJV's translators worked from — each Hebrew word with its own literal English meaning in this verse, prepared by scholars at Tyndale House, Cambridge. The KJV translates whole sentences, not word by word, so its wording differs: one Hebrew word can become several English words, and the KJV may choose “the LORD” where the gloss reads “Yahweh”. Both are faithful — they answer different questions. For the KJV's own rendering, switch to the KJV text.

Use ← → arrow keys to navigate
Settings

Reading Style

Typeface

Font Size 19px

Reading Width 90 chars

Options