Skip to content

Psalms102

Listen to this chapter
0:00 0:00
213 Hebrew words

A Prayer of the Afflicted and Overwhelmed

1
  1. Superscription
  2. תְּפִלָּהTe·fi·laha prayerH8605N-fsNoun Singular Feminine Absolute
  3. לְעָנִיle·'a·Niof an afflicted [person]H6041Prep-l ¦ Adj-msAdjective Singular Masculine Absoluteלְofעָנִיan afflicted [person]
  4. כִיkhiifH3588PrtParticle Conditional
  5. יַעֲטֹףya·'a·Tofhe grows faintH5848V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  6. וְלִפְנֵיve·lif·Neiand <to> beforeH6440Conj-w ¦ Prep-l ¦ N-mpcNoun Plural Masculine Constructוְandלִ<to>פְנֵיbefore
  7. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  8. יִשְׁפֹּךְyish·Pokhhe pours outH8210V-Qal-Imperf-3msVerb Qal Imperfect 3rd Singular Masculine
  9. שִׂיחוֹsi·Chohis complaintH7879N-msc ¦ 3msNoun Singular Masculine Constructשִׂיחcomplaintוֹhis
  10. Verse
  11. יְהוָהYah·wehO YahwehH3068N-properNoun Proper Title
  12. שִׁמְעָהshim·'Ahhear !H8085V-Qal-Imp-2ms ¦ SfxVerb Qal Imperative 2nd Singular Masculineשִׁמְעָhearה!
  13. תְפִלָּתִיte·fi·la·Timy prayerH8605N-fsc ¦ 1csNoun Singular Feminine Constructתְפִלָּתִprayerיmy
  14. וְשַׁוְעָתִיve·shav·'a·Tiand my cry for helpH7775Conj-w ¦ N-fsc ¦ 1csNoun Singular Feminine Constructוְandשַׁוְעָתִcry for helpיmy
  15. אֵלֶיךָ'e·Lei·khato youH413Prep ¦ 2msPrepositionאֵלֶיtoךָyou
  16. תָבוֹאta·Vo'let it comeH935V-Qal-Imperf-3fsVerb Qal Imperfect 3rd Singular Feminine
2
  1. אַל'almay notH408NegParticle Negative
  2. תַּסְתֵּרtas·Teryou hideH5641V-Hiphil-Imperf-2msVerb Hiphil Imperfect 2nd Singular Masculine
  3. פָּנֶיךָpa·Nei·khayour faceH6440N-mpc ¦ 2msNoun Plural Masculine Constructפָּנֶיfaceךָyour
  4. מִמֶּנִּיmi·me·Nifrom meH4480Prep ¦ 1csPrepositionמִמֶּfromנִּיme
  5. בְּיוֹםbe·Yomon [the] dayH3117Prep-b ¦ N-msNoun Singular Masculine Absoluteבְּonיוֹם[the] day
  6. צַרtzar[when] it is distressH6887V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  7. לִיlito mePrep-l ¦ 1csSuffix Personal 1st Singular common genderלִtoיme
  8. הַטֵּהha·tehinclineH5186V-Hiphil-Imp-2msVerb Hiphil Imperative 2nd Singular Masculine
  9. אֵלַי'e·Laito meH413Prep ¦ 1csPrepositionאֵלַtoיme
  10. אָזְנֶךָ'a·ze·Ne·khayour earH241N-fsc ¦ 2msNoun Singular Feminine Constructאָזְנֶearךָyour
  11. בְּיוֹםbe·Yomon [the] dayH3117Prep-b ¦ N-msNoun Singular Masculine Absoluteבְּonיוֹם[the] day
  12. אֶקְרָא'ek·Ra'[when] I will call outH7121V-Qal-Imperf-1csVerb Qal Imperfect 1st Singular common gender
  13. מַהֵרma·HerhurryH4116V-Piel-Imp-2msVerb Piel Imperative 2nd Singular Masculine
  14. עֲנֵנִי'a·Ne·nianswer meH6030V-Qal-Imp-2ms ¦ 1csVerb Qal Imperative 2nd Singular Masculineעֲנֵanswerנִיme
3
  1. כִּיkiforH3588PrtParticle Conditional
  2. כָלוּkha·Luthey have come to an endH3615V-Qal-Perf-3cpVerb Qal Perfect 3rd Plural common gender
  3. בְעָשָׁןve·'a·Shanin smokeH6227Prep-b ¦ N-msNoun Singular Masculine Absoluteבְinעָשָׁןsmoke
  4. יָמָיya·Maimy daysH3117N-mpc ¦ 1csNoun Plural Masculine Constructיָמָdaysיmy
  5. וְעַצְמוֹתַיve·'atz·mo·Taiand my bonesH6106Conj-w ¦ N-fpc ¦ 1csNoun Plural Feminine Constructוְandעַצְמוֹתַbonesיmy
  6. כְּמוֹke·movlikeH3644PrepPreposition
  7. קֵדkeda hearthH4168N-msNoun Singular Masculine Absolute
  8. נִחָרוּni·Cha·ruthey have been burnedH2787V-Niphal-Perf-3cpVerb Niphal Perfect 3rd Plural common gender
4
  1. הוּכָּהhu·kahit has been struckH5221V-Hophal-Perf-3msVerb Hophal Perfect 3rd Singular Masculine
  2. כָעֵשֶׂבKha·'e·sevlike <the> vegetationH6212Prep-k ¦ N-msNoun Singular Masculine Absoluteכָlike <the>עֵשֶׂבvegetation
  3. וַיִּבַשׁvai·yi·Vashand it has witheredH3001Conj-w ¦ V-Qal-ConsecImperf-3msVerb Qal Consecutive Imperfect 3rd Singular Masculineוַandיִּבַשׁit has withered
  4. לִבִּיli·Bimy heartH3820N-msc ¦ 1csNoun Singular Masculine Constructלִבִּheartיmy
  5. כִּיkiforH3588PrtParticle Conditional
  6. שָׁכַחְתִּיSha·Khach·tiI have forgottenH7911V-Qal-Perf-1csVerb Qal Perfect 1st Singular common gender
  7. מֵאֲכֹלme·'a·Kholfrom eatingH398Prep-m ¦ V-Qal-InfVerb Qal Infinitive Constructמֵfromאֲכֹלeating
  8. לַחְמִיlach·Mimy foodH3899N-csc ¦ 1msNoun Singular common gender Constructלַחְמִfoodיmy
5
  1. מִקּוֹלmi·Kolfrom [the] sound ofH6963Prep-m ¦ N-mscNoun Singular Masculine Constructמִfromקּוֹל[the] sound of
  2. אַנְחָתִי'an·cha·Timy groaningH585N-fsc ¦ 1csNoun Singular Feminine Constructאַנְחָתִgroaningיmy
  3. דָּבְקָהda·ve·Kahit clingsH1692V-Qal-Perf-3fsVerb Qal Perfect 3rd Singular Feminine
  4. עַצְמִי'atz·Mimy bone[s]H6106N-fsc ¦ 1csNoun Singular Feminine Constructעַצְמִbone[s]יmy
  5. לִבְשָׂרִיliv·sa·Rito my fleshH1320Prep-l ¦ N-msc ¦ 1csNoun Singular Masculine Constructלִtoבְשָׂרִfleshיmy
6
  1. דָּמִיתִיDa·mi·tiI am likeH1819V-Qal-Perf-1csVerb Qal Perfect 1st Singular common gender
  2. לִקְאַתlik·'At<to> a desert owl ofH6893Prep-l ¦ N-fscNoun Singular Feminine Constructלִ<to>קְאַתa desert owl of
  3. מִדְבָּרmid·Bar[the] wildernessH4057N-msNoun Singular Masculine Absolute
  4. הָיִיתִיha·Yi·tiI amH1961V-Qal-Perf-1csVerb Qal Perfect 1st Singular common gender
  5. כְּכוֹסke·Khoslike an owl ofH3563Prep-k ¦ N-mscNoun Singular Masculine Constructכְּlikeכוֹסan owl of
  6. חֳרָבוֹתcho·ra·Vot[the] waste placesH2723N-fpNoun Plural Feminine Absolute
7
  1. שָׁקַדְתִּיsha·Kad·tiI am wakefulH8245V-Qal-Perf-1csVerb Qal Perfect 1st Singular common gender
  2. וָאֶהְיֶהva·'eh·Yehand I have becomeH1961Conj-w ¦ V-Qal-ConsecImperf-1csVerb Qal Consecutive Imperfect 1st Singular common genderוָandאֶהְיֶהI have become
  3. כְּצִפּוֹרke·tzi·Porlike a birdH6833Prep-k ¦ N-csNoun Singular common gender Absoluteכְּlikeצִפּוֹרa bird
  4. בּוֹדֵדbo·DedisolatedH909V-Qal-Prtcpl-msVerb Qal Participle Singular Masculine Absolute
  5. עַל'alonH5921PrepPreposition
  6. גָּגGaga roofH1406N-msNoun Singular Masculine Absolute
8
  1. כָּלkolallH3605N-mscNoun Singular Masculine Construct
  2. הַיּוֹםHai·yomthe dayH3117Art ¦ N-msNoun Singular Masculine Absoluteהַtheיּוֹםday
  3. חֵרְפוּנִיche·re·Fu·nithey have taunted meH2778V-Piel-Perf-3cp ¦ 1csVerb Piel Perfect 3rd Plural common genderחֵרְפוּthey have tauntedנִיme
  4. אוֹיְבָי'oy·Vaimy enemiesH341V-Qal-Prtcpl-mp ¦ 1csVerb Qal Participle Plural Masculine Constructאוֹיְבָenemiesיmy
  5. מְהוֹלָלַיme·ho·la·Lai[those who] mock meH1984V-Piel-Prtcpl-mp ¦ 1csVerb Piel Participle Plural Masculine Constructמְהוֹלָלַ[those who] mockיme
  6. בִּיbiby mePrep-b ¦ 1csSuffix Personal 1st Singular common genderבִּbyיme
  7. נִשְׁבָּעוּnish·Ba·'uthey have swornH7650V-Niphal-Perf-3cpVerb Niphal Perfect 3rd Plural common gender
9
  1. כִּיkiforH3588PrtParticle Conditional
  2. אֵפֶר'E·ferash[es]H665N-msNoun Singular Masculine Absolute
  3. כַּלֶּחֶםka·Le·chemlike <the> foodH3899Prep-k ¦ N-msNoun Singular Masculine Absoluteכַּlike <the>לֶּחֶםfood
  4. אָכָלְתִּי'a·Khal·tiI have eatenH398V-Qal-Perf-1csVerb Qal Perfect 1st Singular common gender
  5. וְשִׁקֻּוַיve·shi·ku·Vaiand my drinksH8249Conj-w ¦ N-mpc ¦ 1csNoun Plural Masculine Constructוְandשִׁקֻּוַdrinksיmy
  6. בִּבְכִיbiv·Khiwith weepingH1065Prep-b ¦ N-msNoun Singular Masculine Absoluteבִּwithבְכִיweeping
  7. מָסָכְתִּיma·Sa·khe·tiI have mixedH4537V-Qal-Perf-1csVerb Qal Perfect 1st Singular common gender
10
  1. מִפְּנֵיmi·pe·nei<from> because ofH6440Prep-m ¦ N-mpcNoun Plural Masculine Constructמִ<from>פְּנֵיbecause of
  2. זַעַמְךָza·'am·Khayour indignationH2195N-msc ¦ 2msNoun Singular Masculine Constructזַעַמְindignationךָyour
  3. וְקִצְפֶּךָve·kitz·Pe·chaand your wrathH7110Conj-w ¦ N-msc ¦ 2msNoun Singular Masculine Constructוְandקִצְפֶּwrathךָyour
  4. כִּיkiforH3588PrtParticle Conditional
  5. נְשָׂאתַנִיne·sa·Ta·niyou have picked up meH5375V-Qal-Perf-2ms ¦ 1csVerb Qal Perfect 2nd Singular Masculineנְשָׂאתַyou have picked upנִיme
  6. וַתַּשְׁלִיכֵנִיva·tash·li·Khe·niand you have thrown away meH7993Conj-w ¦ V-Hiphil-ConsecImperf-2ms ¦ 1csVerb Hiphil Consecutive Imperfect 2nd Singular Masculineוַandתַּשְׁלִיכֵyou have thrown awayנִיme
11
  1. יָמַיYa·maimy daysH3117N-mpc ¦ 1csNoun Plural Masculine Constructיָמַdaysיmy
  2. כְּצֵלke·Tzel[are] like a shadowH6738Prep-k ¦ N-msNoun Singular Masculine Absoluteכְּ[are] likeצֵלa shadow
  3. נָטוּיna·TuiextendedH5186V-Qal-PassPrtcpl-msVerb Qal Participle Passive Singular Masculine Absolute
  4. וַאֲנִיva·'a·Niand IH589Conj-w ¦ Pro-1csPronoun Personal 1st Singular common genderוַandאֲנִיI
  5. כָּעֵשֶׂבka·'E·sevlike <the> vegetationH6212Prep-k ¦ N-msNoun Singular Masculine Absoluteכָּlike <the>עֵשֶׂבvegetation
  6. אִיבָשׁ'i·VashI am witheringH3001V-Qal-Imperf-1csVerb Qal Imperfect 1st Singular common gender

God's Eternal Reign and Promise to Zion

12
  1. וְאַתָּהve·'a·Tahand youH859Conj-w ¦ Pro-2msPronoun Personal 2nd Singular Masculineוְandאַתָּהyou
  2. יְהוָהYah·wehO YahwehH3068N-properNoun Proper Title
  3. לְעוֹלָםle·'o·Lamfor everH5769Prep-l ¦ N-msNoun Singular Masculine Absoluteלְforעוֹלָםever
  4. תֵּשֵׁבte·Shevyou sitH3427V-Qal-Imperf-2msVerb Qal Imperfect 2nd Singular Masculine
  5. וְזִכְרְךָve·zikh·re·khaand remembrance of youH2143Conj-w ¦ N-msc ¦ 2msNoun Singular Masculine Constructוְandזִכְרְremembrance ofךָyou
  6. לְדֹרle·Dor[is] to a generationH1755Prep-l ¦ N-msNoun Singular Masculine Absoluteלְ[is] toדֹרa generation
  7. וָדֹרva·Dorand a generationH1755Conj-w ¦ N-msNoun Singular Masculine Absoluteוָandדֹרa generation
13
  1. אַתָּה'a·TahyouH859Pro-2msPronoun Personal 2nd Singular Masculine
  2. תָקוּםTa·kumyou will ariseH6965V-Qal-Imperf-2msVerb Qal Imperfect 2nd Singular Masculine
  3. תְּרַחֵםte·ra·Chemyou will have compassion onH7355V-Piel-Imperf-2msVerb Piel Imperfect 2nd Singular Masculine
  4. צִיּוֹןtzi·YonZionH6726N-properNoun Proper Location
  5. כִּיkiforH3588PrtParticle Conditional
  6. עֵת'et[it is] [the] timeH6256N-csNoun Singular common gender Absolute
  7. לְחֶנְנָהּle·che·Nahto show favor to itH2603Prep-l ¦ V-Qal-Inf ¦ 3fsVerb Qal Infinitive Constructלְtoחֶנְנָshow favor toהּit
  8. כִּיkiforH3588PrtParticle Conditional
  9. בָאva'it has comeH935V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  10. מוֹעֵדmo·'Ed[the] appointed timeH4150N-msNoun Singular Masculine Absolute
14
  1. כִּיkiforH3588PrtParticle Conditional
  2. רָצוּra·Tzuthey take pleasure inH7521V-Qal-Perf-3cpVerb Qal Perfect 3rd Plural common gender
  3. עֲבָדֶיךָ'A·va·dei·khayour servantsH5650N-mpc ¦ 2msNoun Plural Masculine Constructעֲבָדֶיservantsךָyour
  4. אֶת'et<obj.>H853DirObjMParticle Object Indicator
  5. אֲבָנֶיהָ'a·va·Nei·haits stonesH68N-fpc ¦ 3fsNoun Plural Feminine Constructאֲבָנֶיstonesהָits
  6. וְאֶתve·'Etand <obj.>H853Conj-w ¦ DirObjMParticle Object Indicatorוְandאֶת<obj.>
  7. עֲפָרָהּ'a·fa·Rahits dustH6083N-msc ¦ 3fsNoun Singular Masculine Constructעֲפָרָdustהּits
  8. יְחֹנֵנוּye·cho·Ne·nuthey show favor toH2603V-Piel-Imperf-3mpVerb Piel Imperfect 3rd Plural Masculine
15
  1. וְיִירְאוּve·yi·re·'Uand they may fearH3372Conj-w ¦ V-Qal-ConjImperf-3mpVerb Qal Conjunction+Imperfect 3rd Plural Masculineוְandיִירְאוּthey may fear
  2. גוֹיִםGo·yimnationsH1471N-mpNoun Plural Masculine Absolute
  3. אֶת'et<obj.>H853DirObjMParticle Object Indicator
  4. שֵׁםshem[the] name ofH8034N-mscNoun Singular Masculine Construct
  5. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  6. וְכָלve·kholand allH3605Conj-w ¦ N-mscNoun Singular Masculine Constructוְandכָלall
  7. מַלְכֵיmal·Khei[the] kings ofH4428N-mpcNoun Plural Masculine Construct
  8. הָאָרֶץha·'A·retzthe earthH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץearth
  9. אֶת'et<obj.>H853DirObjMParticle Object Indicator
  10. כְּבוֹדֶךָke·vo·De·khayour gloryH3519N-msc ¦ 2msNoun Singular Masculine Constructכְּבוֹדֶgloryךָyour
16
  1. כִּיkiforH3588PrtParticle Conditional
  2. בָנָהva·Nahhe has builtH1129V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  3. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  4. צִיּוֹןtzi·YonZionH6726N-properNoun Proper Location
  5. נִרְאָהnir·'Ahhe has appearedH7200V-Niphal-Perf-3msVerb Niphal Perfect 3rd Singular Masculine
  6. בִּכְבוֹדוֹbikh·vo·Doin his gloryH3519Prep-b ¦ N-msc ¦ 3msNoun Singular Masculine Constructבִּinכְבוֹדgloryוֹhis
17
  1. פָּנָהPa·nahhe has turnedH6437V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  2. אֶל'eltoH413PrepPreposition
  3. תְּפִלַּתte·fi·Lat[the] prayer ofH8605N-fscNoun Singular Feminine Construct
  4. הָעַרְעָרha·'ar·'Arthe destitute personH6199Art ¦ N-msNoun Singular Masculine Absoluteהָtheעַרְעָרdestitute person
  5. וְלֹאve·lo'and notH3808Conj-w ¦ NegParticle Negativeוְandלֹאnot
  6. בָזָהva·Zahhe has despisedH959V-Qal-Perf-3msVerb Qal Perfect 3rd Singular Masculine
  7. אֶת'et<obj.>H853DirObjMParticle Object Indicator
  8. תְּפִלָּתָםte·fi·la·Tamtheir prayerH8605N-fsc ¦ 3mpNoun Singular Feminine Constructתְּפִלָּתָprayerםtheir
18
  1. תִּכָּתֶבti·Ka·tevlet it be writtenH3789V-Niphal-Imperf-3fsVerb Niphal Imperfect 3rd Singular Feminine
  2. זֹאתzotthisH2063PrtParticle Demonstrative
  3. לְדוֹרle·Dorfor a generationH1755Prep-l ¦ N-msNoun Singular Masculine Absoluteלְforדוֹרa generation
  4. אַחֲרוֹן'a·cha·RonlaterH314Adj-msAdjective Singular Masculine Absolute
  5. וְעַםve·'Amand a peopleH5971Conj-w ¦ N-msNoun Singular Masculine Absoluteוְandעַםa people
  6. נִבְרָאniv·Ra'[who will] be createdH1254V-Niphal-Prtcpl-msVerb Niphal Participle Singular Masculine Absolute
  7. יְהַלֶּלye·ha·lelit will praiseH1984V-Piel-Imperf-3msVerb Piel Imperfect 3rd Singular Masculine
  8. יָהּYahYahwehH3050N-proper-mNoun Proper Masculine
19
  1. כִּיkiforH3588PrtParticle Conditional
  2. הִשְׁקִיףHish·kifhe has looked downH8259V-Hiphil-Perf-3msVerb Hiphil Perfect 3rd Singular Masculine
  3. מִמְּרוֹםmi·me·Romfrom [the] height ofH4791Prep-m ¦ N-mscNoun Singular Masculine Constructמִfromמְּרוֹם[the] height of
  4. קָדְשׁוֹka·de·Shohis holinessH6944N-msc ¦ 3msNoun Singular Masculine Constructקָדְשׁholinessוֹhis
  5. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  6. מִשָּׁמַיִםmi·sha·Ma·yimfrom heavenH8064Prep-m ¦ N-mpNoun Plural Masculine Absoluteמִfromשָּׁמַיִםheaven
  7. אֶל'eltoH413PrepPreposition
  8. אֶרֶץ'E·retzearthH776N-fsNoun Singular Feminine Absolute
  9. הִבִּיטhi·Bithe has lookedH5027V-Hiphil-Perf-3msVerb Hiphil Perfect 3rd Singular Masculine
20
  1. לִשְׁמֹעַLish·mo·a'to hearH8085Prep-l ¦ V-Qal-InfVerb Qal Infinitive Constructלִtoשְׁמֹעַhear
  2. אֶנְקַת'en·Kat[the] groaning ofH603N-fscNoun Singular Feminine Construct
  3. אָסִיר'a·Sirprisoner[s]H615N-msNoun Singular Masculine Absolute
  4. לְפַתֵּחַle·fa·Te·achto set freeH6605Prep-l ¦ V-Piel-InfVerb Piel Infinitive Constructלְtoפַתֵּחַset free
  5. בְּנֵיbe·Nei[the] sons ofH1121N-mpcNoun Plural Masculine Construct
  6. תְמוּתָהte·mu·TahdeathH8546N-fsNoun Singular Feminine Absolute
21
  1. לְסַפֵּרle·sa·Perto recountH5608Prep-l ¦ V-Piel-InfVerb Piel Infinitive Constructלְtoסַפֵּרrecount
  2. בְּצִיּוֹןBe·tzi·yonin ZionH6726Prep-b ¦ N-properNoun Proper LocationבְּinצִיּוֹןZion
  3. שֵׁםshem[the] name ofH8034N-mscNoun Singular Masculine Construct
  4. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title
  5. וּתְהִלָּתוֹu·te·hi·la·Toand his praiseH8416Conj-w ¦ N-fsc ¦ 3msNoun Singular Feminine Constructוּandתְהִלָּתpraiseוֹhis
  6. בִּירוּשָׁלִָםbi·ru·sha·Limin JerusalemH3389Prep-b ¦ N-properNoun Proper LocationבִּinירוּשָׁלִָםJerusalem
22
  1. בְּהִקָּבֵץbe·hi·ka·Vetzwhen gatherH6908Prep-b ¦ V-Niphal-InfVerb Niphal Infinitive Constructבְּwhenהִקָּבֵץgather
  2. עַמִּים'a·MimpeoplesH5971N-mpNoun Plural Masculine Absolute
  3. יַחְדָּוyach·DavtogetherH3162AdvAdverb
  4. וּמַמְלָכוֹתu·mam·la·Khotand kingdomsH4467Conj-w ¦ N-fpNoun Plural Feminine Absoluteוּandמַמְלָכוֹתkingdoms
  5. לַעֲבֹדla·'a·Vodto serveH5647Prep-l ¦ V-Qal-InfVerb Qal Infinitive Constructלַtoעֲבֹדserve
  6. אֶת'et<obj.>H853DirObjMParticle Object Indicator
  7. יְהוָהYah·wehYahwehH3068N-properNoun Proper Title

The Psalmist Recalls Mortality and God's Eternity

23
  1. עִנָּה'i·Nahhe has humbledH6031V-Piel-Perf-3msVerb Piel Perfect 3rd Singular Masculine
  2. בַדֶּרֶךְva·De·rekhin the wayH1870Prep-b ¦ N-csNoun Singular common gender Absoluteבַin theדֶּרֶךְway
  3. כֹּחִיko·Chimy strengthH3581N-msc ¦ 1csNoun Singular Masculine Constructכֹּחִstrengthיmy
  4. קִצַּרki·Tzarhe has cut shortH7114V-Piel-Perf-3msVerb Piel Perfect 3rd Singular Masculine
  5. יָמָיya·Maimy daysH3117N-mpc ¦ 1csNoun Plural Masculine Constructיָמָdaysיmy
24
  1. אֹמַר'o·MarI saidH559V-Qal-Imperf-1csVerb Qal Imperfect 1st Singular common gender
  2. אֵלִי'e·Limy O GodH410N-msc ¦ 1csNoun Singular Masculine ConstructאֵלִO Godיmy
  3. אַל'almay notH408NegParticle Negative
  4. תַּעֲלֵנִיTa·'al·niyou lift up meH5927V-Hiphil-Imperf-2ms ¦ 1csVerb Hiphil Imperfect 2nd Singular Masculineתַּעֲלֵyou lift upנִיme
  5. בַּחֲצִיba·cha·Tziin [the] middle ofH2677Prep-b ¦ N-mscNoun Singular Masculine Constructבַּinחֲצִי[the] middle of
  6. יָמָיya·Maimy daysH3117N-mpc ¦ 1csNoun Plural Masculine Constructיָמָdaysיmy
  7. בְּדוֹרbe·Dor[are] in a generation ofH1755Prep-b ¦ N-mscNoun Singular Masculine Constructבְּ[are] inדוֹרa generation of
  8. דּוֹרִיםdo·RimgenerationsH1755N-mpNoun Plural Masculine Absolute
  9. שְׁנוֹתֶיךָshe·no·Tei·khayour yearsH8141N-fpc ¦ 2msNoun Plural Feminine Constructשְׁנוֹתֶיyearsךָyour
25
  1. לְפָנִיםLe·fa·nim<to> beforeH6440Prep-l ¦ N-mpNoun Plural Masculine Absoluteלְ<to>פָנִיםbefore
  2. הָאָרֶץha·'A·retzthe earthH776Art ¦ N-fsNoun Singular Feminine Absoluteהָtheאָרֶץearth
  3. יָסַדְתָּya·Sad·tayou foundedH3245V-Qal-Perf-2msVerb Qal Perfect 2nd Singular Masculine
  4. וּמַעֲשֵׂהu·ma·'a·Sehand [were] [the] work ofH4639Conj-w ¦ N-mscNoun Singular Masculine Constructוּandמַעֲשֵׂה[were] [the] work of
  5. יָדֶיךָya·Dei·khayour handsH3027N-cdc ¦ 2msNoun Dual common gender Constructיָדֶיhandsךָyour
  6. שָׁמָיִםsha·Ma·yim[the] heavensH8064N-mpNoun Plural Masculine Absolute
26
  1. הֵמָּהHe·mahtheyH1992Pro-3mpPronoun Personal 3rd Plural Masculine
  2. יֹאבֵדוּyoe·Duthey will perishH6V-Qal-Imperf-3mpVerb Qal Imperfect 3rd Plural Masculine
  3. וְאַתָּהve·'a·Tahand youH859Conj-w ¦ Pro-2msPronoun Personal 2nd Singular Masculineוְandאַתָּהyou
  4. תַעֲמֹדta·'a·Modyou will endureH5975V-Qal-Imperf-2msVerb Qal Imperfect 2nd Singular Masculine
  5. וְכֻלָּםVe·khu·lomand all of themH3605Conj-w ¦ N-msc ¦ 3mpNoun Singular Masculine Constructוְandכֻלָּall ofםthem
  6. כַּבֶּגֶדka·Be·gedlike <the> garmentH899Prep-k ¦ N-msNoun Singular Masculine Absoluteכַּlike <the>בֶּגֶדgarment
  7. יִבְלוּyiv·Luthey will wear outH1086V-Qal-Imperf-3mpVerb Qal Imperfect 3rd Plural Masculine
  8. כַּלְּבוּשׁka·le·Vushlike <the> clothingH3830Prep-k ¦ N-msNoun Singular Masculine Absoluteכַּlike <the>לְּבוּשׁclothing
  9. תַּחֲלִיפֵםta·cha·li·Femyou will change themH2498V-Hiphil-Imperf-2ms ¦ 3mpVerb Hiphil Imperfect 2nd Singular Masculineתַּחֲלִיפֵyou will changeםthem
  10. וְיַחֲלֹפוּVe·ya·cha·Lo·fuand they may pass awayH2498Conj-w ¦ V-Qal-ConjImperf-3mpVerb Qal Conjunction+Imperfect 3rd Plural Masculineוְandיַחֲלֹפוּthey may pass away
27
  1. וְאַתָּהve·'a·tahand youH859Conj-w ¦ Pro-2msPronoun Personal 2nd Singular Masculineוְandאַתָּהyou
  2. הוּאHu'[are] heH1931Pro-3msPronoun Personal 3rd Singular Masculine
  3. וּשְׁנוֹתֶיךָu·she·no·Tei·khaand your yearsH8141Conj-w ¦ N-fpc ¦ 2msNoun Plural Feminine Constructוּandשְׁנוֹתֶיyearsךָyour
  4. לֹאlo'notH3808NegParticle Negative
  5. יִתָּמּוּyi·Ta·muthey will come to an endH8552V-Qal-Imperf-3mpVerb Qal Imperfect 3rd Plural Masculine
28
  1. בְּנֵיbe·nei[the] children ofH1121N-mpcNoun Plural Masculine Construct
  2. עֲבָדֶיךָ'a·va·Dei·khayour servantsH5650N-mpc ¦ 2msNoun Plural Masculine Constructעֲבָדֶיservantsךָyour
  3. יִשְׁכּוֹנוּyish·Ko·nuthey will dwellH7931V-Qal-Imperf-3mpVerb Qal Imperfect 3rd Plural Masculine
  4. וְזַרְעָםve·zar·'Amand their offspringH2233Conj-w ¦ N-msc ¦ 3mpNoun Singular Masculine Constructוְandזַרְעָoffspringםtheir
  5. לְפָנֶיךָle·fa·Nei·kha<to> before youH6440Prep-l ¦ N-mpc ¦ 2msNoun Plural Masculine Constructלְ<to>פָנֶיbeforeךָyou
  6. יִכּוֹןyi·Konit will be establishedH3559V-Niphal-Imperf-3msVerb Niphal Imperfect 3rd Singular Masculine
English is a literal word-by-word gloss of the Hebrew, not the KJV's wording. Why?

This is the original text the KJV's translators worked from — each Hebrew word with its own literal English meaning in this verse, prepared by scholars at Tyndale House, Cambridge. The KJV translates whole sentences, not word by word, so its wording differs: one Hebrew word can become several English words, and the KJV may choose “the LORD” where the gloss reads “Yahweh”. Both are faithful — they answer different questions. For the KJV's own rendering, switch to the KJV text.

Use arrow keys to navigate
Settings

Reading Style

Typeface

Font Size 19px

Reading Width 90 chars

Options